Learn More
3-Chlorobenzo[b]thiophene-2-carbonyl chloride, 95%
CAS: 21815-91-8 | C9H4Cl2OS | 231.09 g/mol
$61.62 - $206.53
Chemical Identifiers
| CAS | 21815-91-8 |
|---|---|
| Molecular Formula | C9H4Cl2OS |
| Molecular Weight (g/mol) | 231.09 |
| MDL Number | MFCD00053069 |
| InChI Key | GWKSSMDJEWPKCM-UHFFFAOYSA-N |
| Synonym | 3-chlorobenzo b thiophene-2-carbonyl chloride, 3-chlorobenzothiophene-2-carbonyl chloride, 3-chloro-benzo b thiophene-2-carbonyl chloride, 3-chlorobenzo b thiophen-2-carbonyl chloride, benzo b thiophene-2-carbonyl chloride, 3-chloro, 3-chlorobenzo b-2-thiophenecarboxylic acid chloride, acmc-1cne6, 3-chlorobenzo b thiophene-2-carbonylchloride, 2-chlorocarbonyl-3-chlorobenzo b thiophene, 3-chlorobenzo thiophene-2-carbonyl chloride |
| PubChem CID | 519898 |
| IUPAC Name | 3-chloro-1-benzothiophene-2-carbonyl chloride |
| SMILES | ClC(=O)C1=C(Cl)C2=CC=CC=C2S1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAL1174503
|
Thermo Scientific Chemicals
L1174503 |
1 g |
Each for $61.62
|
|
|||||
|
AAL1174506
|
Thermo Scientific Chemicals
L1174506 |
5 g |
Each for $206.53
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 21815-91-8 | |
| 231.09 | |
| GWKSSMDJEWPKCM-UHFFFAOYSA-N | |
| 519898 | |
| ClC(=O)C1=C(Cl)C2=CC=CC=C2S1 |
| C9H4Cl2OS | |
| MFCD00053069 | |
| 3-chlorobenzo b thiophene-2-carbonyl chloride, 3-chlorobenzothiophene-2-carbonyl chloride, 3-chloro-benzo b thiophene-2-carbonyl chloride, 3-chlorobenzo b thiophen-2-carbonyl chloride, benzo b thiophene-2-carbonyl chloride, 3-chloro, 3-chlorobenzo b-2-thiophenecarboxylic acid chloride, acmc-1cne6, 3-chlorobenzo b thiophene-2-carbonylchloride, 2-chlorocarbonyl-3-chlorobenzo b thiophene, 3-chlorobenzo thiophene-2-carbonyl chloride | |
| 3-chloro-1-benzothiophene-2-carbonyl chloride |
Specifications
| 21815-91-8 | |
| C9H4Cl2OS | |
| 1 g | |
| 1309703 | |
| 3-chlorobenzo b thiophene-2-carbonyl chloride, 3-chlorobenzothiophene-2-carbonyl chloride, 3-chloro-benzo b thiophene-2-carbonyl chloride, 3-chlorobenzo b thiophen-2-carbonyl chloride, benzo b thiophene-2-carbonyl chloride, 3-chloro, 3-chlorobenzo b-2-thiophenecarboxylic acid chloride, acmc-1cne6, 3-chlorobenzo b thiophene-2-carbonylchloride, 2-chlorocarbonyl-3-chlorobenzo b thiophene, 3-chlorobenzo thiophene-2-carbonyl chloride | |
| ClC(=O)C1=C(Cl)C2=CC=CC=C2S1 | |
| 231.09 | |
| 231.1 | |
| 3-Chlorobenzo[b]thiophene-2-carbonyl chloride |
| 111°C to 114°C | |
| MFCD00053069 | |
| UN3261 | |
| Moisture sensitive | |
| GWKSSMDJEWPKCM-UHFFFAOYSA-N | |
| 3-chloro-1-benzothiophene-2-carbonyl chloride | |
| 519898 | |
| 95% |
Safety and Handling
GHS H Statement
H314-H318
Causes severe skin burns and eye damage.
Causes serious eye damage.
P260-P264b-P271-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P501c
H314-H335
DOTInformation : Hazard Class: 8; Packaging Group: III
EINECSNumber : 625-793-6
TSCA : No
Recommended Storage : Ambient temperatures
RUO – Research Use Only