Learn More
3-Aminobenzeneboronic acid hemisulfate, 98+%
CAS: 66472-86-4 | C12H18B2N2O8S | 371.96 g/mol
$69.73 - $771.44
Chemical Identifiers
| CAS | 66472-86-4 |
|---|---|
| Molecular Formula | C12H18B2N2O8S |
| Molecular Weight (g/mol) | 371.96 |
| MDL Number | MFCD00013111 |
| InChI Key | UKTAURVTSWDIQR-UHFFFAOYSA-N |
| Synonym | 3-aminophenyl boronic acid sulfate 2:1, 3-aminobenzeneboronic acid hemisulfate salt, 3-aminophenylboronic acid hemisulfate, 3-aminobenzeneboronic acid hemisulfate, 3-aminophenylboronic acid hemisulphate, 4-aminophenylboronic acid hemisulfate, m-aminophenyl boronic acid, hemisulphate, boronic acid, 3-aminophenyl-, sulfate 2:1, 3-aminophenyl boronic acid; sulfuric acid, bis m-aminophenylboronic acid ; sulfuric acid |
| PubChem CID | 16211139 |
| IUPAC Name | (3-aminophenyl)boronic acid;sulfuric acid |
| SMILES | OS(O)(=O)=O.NC1=CC=CC(=C1)B(O)O.NC1=CC=CC(=C1)B(O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1724003
|
Thermo Scientific Chemicals
A1724003 |
1 g |
Each for $69.73
|
|
|||||
|
AAA1724006
|
Thermo Scientific Chemicals
A1724006 |
5 g |
Each for $215.37
|
|
|||||
|
AAA1724014
|
Thermo Scientific Chemicals
A1724014 |
25 g |
Each for $771.44
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 66472-86-4 | |
| 371.96 | |
| UKTAURVTSWDIQR-UHFFFAOYSA-N | |
| 16211139 | |
| OS(O)(=O)=O.NC1=CC=CC(=C1)B(O)O.NC1=CC=CC(=C1)B(O)O |
| C12H18B2N2O8S | |
| MFCD00013111 | |
| 3-aminophenyl boronic acid sulfate 2:1, 3-aminobenzeneboronic acid hemisulfate salt, 3-aminophenylboronic acid hemisulfate, 3-aminobenzeneboronic acid hemisulfate, 3-aminophenylboronic acid hemisulphate, 4-aminophenylboronic acid hemisulfate, m-aminophenyl boronic acid, hemisulphate, boronic acid, 3-aminophenyl-, sulfate 2:1, 3-aminophenyl boronic acid; sulfuric acid, bis m-aminophenylboronic acid ; sulfuric acid | |
| (3-aminophenyl)boronic acid;sulfuric acid |
Specifications
| 66472-86-4 | |
| C12H18B2N2O8S | |
| 1 g | |
| Hygroscopic | |
| UKTAURVTSWDIQR-UHFFFAOYSA-N | |
| (3-aminophenyl)boronic acid;sulfuric acid | |
| 16211139 | |
| ≥98% |
| >300°C | |
| MFCD00013111 | |
| 8094151 | |
| 3-aminophenyl boronic acid sulfate 2:1, 3-aminobenzeneboronic acid hemisulfate salt, 3-aminophenylboronic acid hemisulfate, 3-aminobenzeneboronic acid hemisulfate, 3-aminophenylboronic acid hemisulphate, 4-aminophenylboronic acid hemisulfate, m-aminophenyl boronic acid, hemisulphate, boronic acid, 3-aminophenyl-, sulfate 2:1, 3-aminophenyl boronic acid; sulfuric acid, bis m-aminophenylboronic acid ; sulfuric acid | |
| OS(O)(=O)=O.NC1=CC=CC(=C1)B(O)O.NC1=CC=CC(=C1)B(O)O | |
| 371.96 | |
| 185.98 | |
| 3-Aminobenzeneboronic acid hemisulfate |
Safety and Handling
GHS H Statement
H315-H319-H335
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
H315-H319-H335
EINECSNumber : 266-376-5
TSCA : No
Recommended Storage : Ambient temperatures
RUO – Research Use Only