missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3,5-Dibromo-o-phenylenediamine monohydrochloride, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 223735000
| Quantity | 500mg |
|---|---|
| Packaging | Glass bottle |
Chemical Identifiers
| 75568-11-5 | |
| 302.4 | |
| QOZDVKFQMGARCC-UHFFFAOYSA-N | |
| 2724285 | |
| C1=C(C=C(C(=C1Br)N)N)Br.Cl |
| C6H6Br2N2·HCl | |
| MFCD00012967 | |
| 3,5-dibromo-1,2-phenylenediamine monohydrochloride, 3,5-dibromobenzene-1,2-diamine hydrochloride, acmc-20andn, 1,2-diamino-3,5-dibromobenzene monohydrochloride, 3,5-bis bromanyl benzene-1,2-diamine hydrochloride, 3,5-dibromo-1,2-phenylenediamine hydrochloride, 1,2-benzenediamine,3,5-dibromo-, hydrochloride 1:1, 3,5-dibromo-ortho-phenylenediamine monohydrochloride, 3,5-dibromobenzene-1,2-diamine-hydrogen chloride 1/1, 3,5-dibromo-1,2-phenylenediaminemonohydrochloride sensitivereagentforthedeterminationofsebygc-ecd | |
| 3,5-dibromobenzene-1,2-diamine;hydrochloride |
Specifications
| 3, 5-Dibromo-o-phenylenediamine monohydrochloride | |
| 75568-11-5 | |
| 100.0 | |
| 99% | |
| C6H6Br2N2·HCl | |
| 500mg | |
| 13, 29 | |
| QOZDVKFQMGARCC-UHFFFAOYSA-N | |
| 3,5-dibromobenzene-1,2-diamine;hydrochloride | |
| 2724285 | |
| 99% |
| 99% | |
| 98.5 | |
| Authentic | |
| Glass bottle | |
| Br2C6H2(NH2)2·HCl | |
| MFCD00012967 | |
| 3,5-dibromo-1,2-phenylenediamine monohydrochloride, 3,5-dibromobenzene-1,2-diamine hydrochloride, acmc-20andn, 1,2-diamino-3,5-dibromobenzene monohydrochloride, 3,5-bis bromanyl benzene-1,2-diamine hydrochloride, 3,5-dibromo-1,2-phenylenediamine hydrochloride, 1,2-benzenediamine,3,5-dibromo-, hydrochloride 1:1, 3,5-dibromo-ortho-phenylenediamine monohydrochloride, 3,5-dibromobenzene-1,2-diamine-hydrogen chloride 1/1, 3,5-dibromo-1,2-phenylenediaminemonohydrochloride sensitivereagentforthedeterminationofsebygc-ecd | |
| C1=C(C=C(C(=C1Br)N)N)Br.Cl | |
| 302.4 | |
| 302.4 |
Safety and Handling
TSCA : TSCA
Promotions
Expires: 06-30-2027
Get Up to $1,800 in Chemicals with Purchase
Spend $250 or more on Thermo Fisher Scientific chemicals and get up to $1,800 to spend on additional chemicals.