Learn More
3,4-Dimethoxybenzenesulfonyl chloride, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 354390250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 3, 4-Dimethoxybenzenesulfonyl chloride | |
| 23095-31-0 | |
| 100.0 | |
| 96% min. (HPLC) | |
| C8H9ClO4S | |
| MFCD00051769 | |
| 3,4-dimethoxybenzene-1-sulfonyl chloride, 3,4-dimethoxybenzenesulfonylchloride, 3,4-dimethoxyphenylsulfonyl chloride, 3,4-dimethoxy benzenesulfonyl chloride, benzenesulfonyl chloride, 3,4-dimethoxy, 3,4-dimethoxyphenyl chlorosulfone, pubchem5127, acmc-1co88, asischem d48920, zerenex zx009571 | |
| COC1=C(C=C(C=C1)S(=O)(=O)Cl)OC | |
| 236.68 | |
| 236.68 |
| 97% | |
| 96.0 | |
| Authentic | |
| Glass bottle | |
| (CH3O)2C6H3SO2Cl | |
| 25g | |
| RSJSYCZYQNJQPY-UHFFFAOYSA-N | |
| 3,4-dimethoxybenzenesulfonyl chloride | |
| 2734183 | |
| 97% |
Chemical Identifiers
| 23095-31-0 | |
| 236.68 | |
| RSJSYCZYQNJQPY-UHFFFAOYSA-N | |
| 2734183 | |
| COC1=C(C=C(C=C1)S(=O)(=O)Cl)OC |
| C8H9ClO4S | |
| MFCD00051769 | |
| 3,4-dimethoxybenzene-1-sulfonyl chloride, 3,4-dimethoxybenzenesulfonylchloride, 3,4-dimethoxyphenylsulfonyl chloride, 3,4-dimethoxy benzenesulfonyl chloride, benzenesulfonyl chloride, 3,4-dimethoxy, 3,4-dimethoxyphenyl chlorosulfone, pubchem5127, acmc-1co88, asischem d48920, zerenex zx009571 | |
| 3,4-dimethoxybenzenesulfonyl chloride |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
RUO â Research Use Only