missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3,4-Diethoxybenzoic acid, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 206170250
Description
Specifications
| 3, 4-Diethoxybenzoic acid | |
| 5409-31-4 | |
| 100.0 | |
| 99% | |
| C11H14O4 | |
| MFCD00002504 | |
| 10, 395 | |
| VVKCVAPLTRZJHH-UHFFFAOYSA-N | |
| 3,4-diethoxybenzoic acid | |
| 79417 | |
| 99% |
| 99% | |
| 98.5 | |
| Authentic | |
| Glass bottle | |
| (C2H5O)2C6H3CO2H | |
| 25g | |
| benzoic acid, 3,4-diethoxy, benzoicacid34diethoxy, 3,4-diethoxy-benzoic acid, acmc-1apyn, ksc271i5p, 3,4-bis ethyloxy benzoic acid, 3,4-diethoxybenzoic acid | |
| CCOC1=C(C=C(C=C1)C(=O)O)OCC | |
| 210.23 | |
| 210.23 |
Chemical Identifiers
| 5409-31-4 | |
| 210.23 | |
| VVKCVAPLTRZJHH-UHFFFAOYSA-N | |
| 79417 | |
| CCOC1=C(C=C(C=C1)C(=O)O)OCC |
| C11H14O4 | |
| MFCD00002504 | |
| benzoic acid, 3,4-diethoxy, benzoicacid34diethoxy, 3,4-diethoxy-benzoic acid, acmc-1apyn, ksc271i5p, 3,4-bis ethyloxy benzoic acid, 3,4-diethoxybenzoic acid | |
| 3,4-diethoxybenzoic acid |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
GHS Signal Word: Warning
EINECSNumber : 226-478-2
RUO â Research Use Only