missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3,4,9,10-Perylenetetracarboxylic dianhydride, 98%
CAS: 128-69-8 | C24H8O6 | 392.32 g/mol
$290.52 - $290.52
Chemical Identifiers
| CAS | 128-69-8 |
|---|---|
| Molecular Formula | C24H8O6 |
| Molecular Weight (g/mol) | 392.32 |
| MDL Number | MFCD00006916 |
| InChI Key | CLYVDMAATCIVBF-UHFFFAOYSA-N |
| Synonym | 3,4,9,10-perylenetetracarboxylic dianhydride, pigment red 224, ptcda, perylene-3,4,9,10-tetracarboxylic dianhydride, perylenetetracarboxylic anhydride, anthra 2,1,9-def:6,5,10-d'e'f' diisochromene-1,3,8,10-tetraone, perylo 3,4-cd:9,10-c'd' dipyran-1,3,8,10-tetrone, perylenetetracarboxylic acid dianhydride, 3,4:9,10-perylenetetracarboxylic anhydride |
| PubChem CID | 67191 |
| IUPAC Name | 7,18-dioxaheptacyclo[14.6.2.2²,âµ.0³,¹².0â´,â¹.0¹³,²³.0²â°,²â´]hexacosa-1(22),2(26),3,5(25),9,11,13,15,20,23-decaene-6,8,17,19-tetrone |
| SMILES | O=C1OC(=O)C2=CC=C3C4=CC=C5C(=O)OC(=O)C6=CC=C(C7=CC=C1C2=C37)C4=C56 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC130081000
|
Thermo Scientific Chemicals
130081000 |
100 g | Glass bottle |
Each for $290.52
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 128-69-8 | |
| 392.32 | |
| CLYVDMAATCIVBF-UHFFFAOYSA-N | |
| 67191 | |
| O=C1OC(=O)C2=CC=C3C4=CC=C5C(=O)OC(=O)C6=CC=C(C7=CC=C1C2=C37)C4=C56 |
| C24H8O6 | |
| MFCD00006916 | |
| 3,4,9,10-perylenetetracarboxylic dianhydride, pigment red 224, ptcda, perylene-3,4,9,10-tetracarboxylic dianhydride, perylenetetracarboxylic anhydride, anthra 2,1,9-def:6,5,10-d'e'f' diisochromene-1,3,8,10-tetraone, perylo 3,4-cd:9,10-c'd' dipyran-1,3,8,10-tetrone, perylenetetracarboxylic acid dianhydride, 3,4:9,10-perylenetetracarboxylic anhydride | |
| 7,18-dioxaheptacyclo[14.6.2.2²,âµ.0³,¹².0â´,â¹.0¹³,²³.0²â°,²â´]hexacosa-1(22),2(26),3,5(25),9,11,13,15,20,23-decaene-6,8,17,19-tetrone |
Specifications
| 128-69-8 | |
| 100.0 | |
| Red | |
| 97.5% min | |
| C24H8O6 | |
| 100 g | |
| Solubility in water: insoluble. Other solubilities: sparingly soluble in dil.alkalies and conc. h2so4, insoluble in most common organic solvents | |
| O=C1OC(=O)C2=CC=C3C4=CC=C5C(=O)OC(=O)C6=CC=C(C7=CC=C1C2=C37)C4=C56 | |
| 392.32 | |
| 392.32 | |
| Powder |
| 97.5 | |
| >350.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00006916 | |
| 3,4,9,10-perylenetetracarboxylic dianhydride, pigment red 224, ptcda, perylene-3,4,9,10-tetracarboxylic dianhydride, perylenetetracarboxylic anhydride, anthra 2,1,9-def:6,5,10-d'e'f' diisochromene-1,3,8,10-tetraone, perylo 3,4-cd:9,10-c'd' dipyran-1,3,8,10-tetrone, perylenetetracarboxylic acid dianhydride, 3,4:9,10-perylenetetracarboxylic anhydride | |
| CLYVDMAATCIVBF-UHFFFAOYSA-N | |
| 7,18-dioxaheptacyclo[14.6.2.2²,âµ.0³,¹².0â´,â¹.0¹³,²³.0²â°,²â´]hexacosa-1(22),2(26),3,5(25),9,11,13,15,20,23-decaene-6,8,17,19-tetrone | |
| 67191 | |
| 98% | |
| 3,4,9,10-Perylenetetracarboxylic dianhydride, 98% |
Safety and Handling
MOISTURE SENSITIVE
EINECSNumber : 204-905-3
TSCA : TSCA
RUO – Research Use Only