Learn More
3,4,5-Trimethoxybenzoic acid, 99%
CAS: 118-41-2 | C10H12O5 | 212.2 g/mol
$34.07 - $341.64
Chemical Identifiers
| CAS | 118-41-2 |
|---|---|
| Molecular Formula | C10H12O5 |
| Molecular Weight (g/mol) | 212.2 |
| MDL Number | MFCD00002501 |
| InChI Key | SJSOFNCYXJUNBT-UHFFFAOYSA-N |
| Synonym | eudesmic acid, gallic acid trimethyl ether, tri-o-methylgallic acid, trimethylgallic acid, benzoic acid, 3,4,5-trimethoxy, veratric acid, 5-methoxy, unii-v5c9h0sc9f, 3,4,5-trimethoxy-benzoic acid, 5-methoxy-veratric acid, v5c9h0sc9f |
| PubChem CID | 8357 |
| ChEBI | CHEBI:454991 |
| IUPAC Name | 3,4,5-trimethoxybenzoic acid |
| SMILES | COC1=CC(=CC(OC)=C1OC)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC139930050
|
Thermo Scientific Chemicals
139930050 |
5 g | Glass Bottle |
Each for $34.07
|
|
||||
|
AC139931000
|
Thermo Scientific Chemicals
139931000 |
100 g | Plastic bottle |
Each for $79.74
|
|
||||
|
AC139935000
|
Thermo Scientific Chemicals
139935000 |
500 g | Plastic bottle |
Each for $341.64
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 118-41-2 | |
| 212.2 | |
| SJSOFNCYXJUNBT-UHFFFAOYSA-N | |
| 8357 | |
| 3,4,5-trimethoxybenzoic acid |
| C10H12O5 | |
| MFCD00002501 | |
| eudesmic acid, gallic acid trimethyl ether, tri-o-methylgallic acid, trimethylgallic acid, benzoic acid, 3,4,5-trimethoxy, veratric acid, 5-methoxy, unii-v5c9h0sc9f, 3,4,5-trimethoxy-benzoic acid, 5-methoxy-veratric acid, v5c9h0sc9f | |
| CHEBI:454991 | |
| COC1=CC(=CC(OC)=C1OC)C(O)=O |
Specifications
| 118-41-2 | |
| 100 | |
| Colorless to Yellow | |
| Authentic | |
| Glass Bottle | |
| (CH3O)3C6H2CO2H | |
| 5 g | |
| eudesmic acid, gallic acid trimethyl ether, tri-o-methylgallic acid, trimethylgallic acid, benzoic acid, 3,4,5-trimethoxy, veratric acid, 5-methoxy, unii-v5c9h0sc9f, 3,4,5-trimethoxy-benzoic acid, 5-methoxy-veratric acid, v5c9h0sc9f | |
| COC1=CC(=CC(OC)=C1OC)C(O)=O | |
| 212.2 | |
| CHEBI:454991 | |
| 0.99 | |
| 3, 4, 5-Trimethoxybenzoic acid, 0.99 |
| 98.5 | |
| 168.0°C to 172.0°C | |
| 225.0°C to 227.0°C (10.0 mmHg) | |
| 0.99 | |
| C10H12O5 | |
| MFCD00002501 | |
| 10, 481 | |
| SJSOFNCYXJUNBT-UHFFFAOYSA-N | |
| 3,4,5-trimethoxybenzoic acid | |
| 8357 | |
| 212.2 | |
| Liquid |
Safety and Handling
GHS P Statement Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation.
GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Wear protective gloves/protective clothing/eye protection/face protection.
EINECSNumber : 204-248-2
TSCA : TSCA
RUO – Research Use Only