missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-(Trifluoromethyl)-1H-indole, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 446560010
| Quantity | 1g |
|---|
Chemical Identifiers
| 51310-54-4 | |
| 185.15 | |
| 2-trifluoromethyl-1h-indole, 2-trifluoromethylindole, 1h-indole, 2-trifluoromethyl, pubchem23796, 2-trifluoromethyl indole | |
| 2-(trifluoromethyl)-1H-indole |
| C9H6F3N | |
| QFHVHZJGQWMBTE-UHFFFAOYSA-N | |
| 10932124 | |
| C1=CC=C2C(=C1)C=C(N2)C(F)(F)F |
Specifications
| 2-(Trifluoromethyl)-1H-indole | |
| 96% min. (GC) | |
| C9H6F3N | |
| 2-trifluoromethyl-1h-indole, 2-trifluoromethylindole, 1h-indole, 2-trifluoromethyl, pubchem23796, 2-trifluoromethyl indole | |
| C1=CC=C2C(=C1)C=C(N2)C(F)(F)F | |
| 185.15 | |
| 185.15 |
| 51310-54-4 | |
| Glass Bottle | |
| 1g | |
| QFHVHZJGQWMBTE-UHFFFAOYSA-N | |
| 2-(trifluoromethyl)-1H-indole | |
| 10932124 | |
| 97% |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning