Learn More
2-tert-Butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine, 98%
CAS: 98015-45-3 | C13H31N4P | 274.39 g/mol
$848.06 - $848.06
Chemical Identifiers
| CAS | 98015-45-3 |
|---|---|
| Molecular Formula | C13H31N4P |
| Molecular Weight (g/mol) | 274.39 |
| InChI Key | VSCBATMPTLKTOV-UHFFFAOYSA-N |
| Synonym | bemp, bemp phosphazene, 2-tert-butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine, unii-df15j146qi, 2-tert-butylimino-2-diethylamino-1,3-dimethylperhydro-1,3,2-diazaphosphorine, 2-tert-butylimino-n,n-diethyl-1,3-dimethyl-1,3,2??-diazaphosphinan-2-amine, 2-tert-butylimino-n,n-diethyl-1,3-dimethyl-1,3,2, 2-t-butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine, 2-tert-butylimino-2-diethylamino-1,3-dimethyl-1,3,2-diazaphosphorinane |
| PubChem CID | 3513851 |
| IUPAC Name | 2-tert-butylimino-N,N-diethyl-1,3-dimethyl-1,3,2$l^{5}-diazaphosphinan-2-amine |
| SMILES | CCN(CC)P1(=NC(C)(C)C)N(CCCN1C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC439160050
|
Thermo Scientific Chemicals
439160050 |
5 mL | Glass bottle |
Each for $848.06
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 98015-45-3 | |
| 274.39 | |
| bemp, bemp phosphazene, 2-tert-butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine, unii-df15j146qi, 2-tert-butylimino-2-diethylamino-1,3-dimethylperhydro-1,3,2-diazaphosphorine, 2-tert-butylimino-n,n-diethyl-1,3-dimethyl-1,3,2??-diazaphosphinan-2-amine, 2-tert-butylimino-n,n-diethyl-1,3-dimethyl-1,3,2, 2-t-butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine, 2-tert-butylimino-2-diethylamino-1,3-dimethyl-1,3,2-diazaphosphorinane | |
| 2-tert-butylimino-N,N-diethyl-1,3-dimethyl-1,3,2$l^{5}-diazaphosphinan-2-amine |
| C13H31N4P | |
| VSCBATMPTLKTOV-UHFFFAOYSA-N | |
| 3513851 | |
| CCN(CC)P1(=NC(C)(C)C)N(CCCN1C)C |
Specifications
| 98015-45-3 | |
| 100.0 | |
| 0.9480g/mL | |
| 53°C | |
| 97.5% min. (GC) | |
| C13H31N4P | |
| 0.948 | |
| VSCBATMPTLKTOV-UHFFFAOYSA-N | |
| 2-tert-butylimino-N,N-diethyl-1,3-dimethyl-1,3,2$l^{5}-diazaphosphinan-2-amine | |
| 3513851 | |
| 98% | |
| 2-tert-Butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine |
| 97.5 | |
| Colorless | |
| 74°C (0.1 mmHg) | |
| Authentic | |
| Glass bottle | |
| 5 mL | |
| bemp, bemp phosphazene, 2-tert-butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine, unii-df15j146qi, 2-tert-butylimino-2-diethylamino-1,3-dimethylperhydro-1,3,2-diazaphosphorine, 2-tert-butylimino-n,n-diethyl-1,3-dimethyl-1,3,2??-diazaphosphinan-2-amine, 2-tert-butylimino-n,n-diethyl-1,3-dimethyl-1,3,2, 2-t-butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine, 2-tert-butylimino-2-diethylamino-1,3-dimethyl-1,3,2-diazaphosphorinane | |
| CCN(CC)P1(=NC(C)(C)C)N(CCCN1C)C | |
| 274.39 | |
| 274.39 | |
| Liquid |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
Flammable liquid and vapour.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN (or hair): Take off im
GHS Signal Word: Danger
RUO – Research Use Only