Learn More
2-Sulfobenzoic anhydride, 94%
CAS: 81-08-3 | C7H4O4S | 184.165 g/mol
$135.58 - $1431.66
Chemical Identifiers
| CAS | 81-08-3 |
|---|---|
| Molecular Formula | C7H4O4S |
| Molecular Weight (g/mol) | 184.165 |
| MDL Number | MFCD00005879 |
| InChI Key | NCYNKWQXFADUOZ-UHFFFAOYSA-N |
| Synonym | 2-sulfobenzoic anhydride, 2-sulfobenzoic acid cyclic anhydride, sulfobenzoic anhydride, o-sulfobenzoic acid anhydride, 3h-2,1-benzoxathiol-3-one, 1,1-dioxide, 3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide, unii-0swh68iq5w, o-sulfobenzoic acid, cyclic anhydride, 2,1-benzoxathiol-3-one-1,1-dioxide, 0swh68iq5w |
| PubChem CID | 65729 |
| IUPAC Name | 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one |
| SMILES | C1=CC=C2C(=C1)C(=O)OS2(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1331414
|
Thermo Scientific Chemicals
A1331414 |
25 g |
Each for $135.58
|
|
|||||
|
AAA1331422
|
Thermo Scientific Chemicals
A1331422 |
100 g |
Each for $361.89
|
|
|||||
|
AAA1331436
|
Thermo Scientific Chemicals
A1331436 |
500 g |
Each for $1,431.66
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 81-08-3 | |
| 184.165 | |
| NCYNKWQXFADUOZ-UHFFFAOYSA-N | |
| 65729 | |
| C1=CC=C2C(=C1)C(=O)OS2(=O)=O |
| C7H4O4S | |
| MFCD00005879 | |
| 2-sulfobenzoic anhydride, 2-sulfobenzoic acid cyclic anhydride, sulfobenzoic anhydride, o-sulfobenzoic acid anhydride, 3h-2,1-benzoxathiol-3-one, 1,1-dioxide, 3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide, unii-0swh68iq5w, o-sulfobenzoic acid, cyclic anhydride, 2,1-benzoxathiol-3-one-1,1-dioxide, 0swh68iq5w | |
| 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one |
Specifications
| 81-08-3 | |
| 184°C to 186°C (18 mmHg) | |
| MFCD00005879 | |
| 139893 | |
| 2-sulfobenzoic anhydride, 2-sulfobenzoic acid cyclic anhydride, sulfobenzoic anhydride, o-sulfobenzoic acid anhydride, 3h-2,1-benzoxathiol-3-one, 1,1-dioxide, 3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide, unii-0swh68iq5w, o-sulfobenzoic acid, cyclic anhydride, 2,1-benzoxathiol-3-one-1,1-dioxide, 0swh68iq5w | |
| C1=CC=C2C(=C1)C(=O)OS2(=O)=O | |
| 184.165 | |
| 184.17 | |
| 2-Sulfobenzoic anhydride |
| ∼120°C | |
| C7H4O4S | |
| 25 g | |
| Moisture sensitive | |
| NCYNKWQXFADUOZ-UHFFFAOYSA-N | |
| 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one | |
| 65729 | |
| 94% |
Safety and Handling
GHS H Statement
H315-H319-H335
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
P260-P264b-P270-P271-P280-P303+P361+P353-P304+P340-P305+P351+P338-P310-P330-P331-P363-P501c
H302+H312+H332-H314-H335
EINECSNumber : 201-322-6
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only