Learn More
2-Sulfobenzoic acid cyclic anhydride, 95%
CAS: 81-08-3 | C7H4O4S | 184.17 g/mol
$471.31 - $471.31
Chemical Identifiers
| CAS | 81-08-3 |
|---|---|
| Molecular Formula | C7H4O4S |
| Molecular Weight (g/mol) | 184.17 |
| MDL Number | MFCD00005879 |
| InChI Key | NCYNKWQXFADUOZ-UHFFFAOYSA-N |
| Synonym | 2-sulfobenzoic anhydride, 2-sulfobenzoic acid cyclic anhydride, sulfobenzoic anhydride, o-sulfobenzoic acid anhydride, 3h-2,1-benzoxathiol-3-one, 1,1-dioxide, 3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide, unii-0swh68iq5w, o-sulfobenzoic acid, cyclic anhydride, 2,1-benzoxathiol-3-one-1,1-dioxide, 0swh68iq5w |
| PubChem CID | 65729 |
| IUPAC Name | 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one |
| SMILES | C1=CC=C2C(=C1)C(=O)OS2(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC184751000
|
Thermo Scientific Chemicals
184751000 |
100 g | Glass bottle |
Each for $471.31
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 81-08-3 | |
| 184.17 | |
| NCYNKWQXFADUOZ-UHFFFAOYSA-N | |
| 65729 | |
| C1=CC=C2C(=C1)C(=O)OS2(=O)=O |
| C7H4O4S | |
| MFCD00005879 | |
| 2-sulfobenzoic anhydride, 2-sulfobenzoic acid cyclic anhydride, sulfobenzoic anhydride, o-sulfobenzoic acid anhydride, 3h-2,1-benzoxathiol-3-one, 1,1-dioxide, 3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide, unii-0swh68iq5w, o-sulfobenzoic acid, cyclic anhydride, 2,1-benzoxathiol-3-one-1,1-dioxide, 0swh68iq5w | |
| 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one |
Specifications
| 81-08-3 | |
| 100.0 | |
| White to Beige | |
| Authentic | |
| Glass bottle | |
| MFCD00005879 | |
| 2-sulfobenzoic anhydride, 2-sulfobenzoic acid cyclic anhydride, sulfobenzoic anhydride, o-sulfobenzoic acid anhydride, 3h-2,1-benzoxathiol-3-one, 1,1-dioxide, 3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide, unii-0swh68iq5w, o-sulfobenzoic acid, cyclic anhydride, 2,1-benzoxathiol-3-one-1,1-dioxide, 0swh68iq5w | |
| C1=CC=C2C(=C1)C(=O)OS2(=O)=O | |
| 184.17 | |
| 184.17 | |
| Technical | |
| 2-Sulfobenzoic acid cyclic anhydride, tech., 90% |
| 94.0 | |
| 116°C to 127°C | |
| 184°C to 186°C (18.0 mmHg) | |
| 95% | |
| C7H4O4S | |
| 100 g | |
| NCYNKWQXFADUOZ-UHFFFAOYSA-N | |
| 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one | |
| 65729 | |
| 95% | |
| Crystalline Powder or Crystals |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation occurs: Get medical advice/attention.
If eye irritation persists: Get medical advice/attention.
Wear protective gloves/protective clothing/eye protec
GHS Signal Word: Warning
EINECSNumber : 201-322-6
TSCA : TSCA
RUO – Research Use Only