missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-(Pivalamido)phenylboronic Acid (contains varying amounts of Anhydride), TCI America™
Supplier: TCI America P20431G
Specifications
| 2-(Pivalamido)phenylboronic Acid (contains varying amounts of Anhydride) | |
| 271°C | |
| C11H16BNO3 | |
| 1 g | |
| MXRAJVMTCAUABO-UHFFFAOYSA-N | |
| [2-(2,2-dimethylpropanamido)phenyl]boronic acid | |
| 4193502 | |
| Crystalline Powder |
| 146140-95-6 | |
| White | |
| MFCD01114645 | |
| 2-tert-butylcarbonylamino phenylboronic acid, 2-pivalamidophenyl boronic acid, 2-pivalamido phenylboronic acid, 2-pivaloylamino phenylboronic acid, 2-2,2-dimethylpropanoylamino phenyl boronic acid, 2-pivaloylaminobenzene boronic acid, 2-2,2-dimethylpropanamido phenylboronic acid, 2-2,2,2-trimethylacetamido benzeneboronic acid, 2-2,2-dimethyl-propionylamino phenylboronic acid, boronic acid,b-2-2,2-dimethyl-1-oxopropyl amino phenyl | |
| CC(C)(C)C(=O)NC1=CC=CC=C1B(O)O | |
| 221.06 | |
| 221.06 |
Chemical Identifiers
| 146140-95-6 | |
| 221.06 | |
| MXRAJVMTCAUABO-UHFFFAOYSA-N | |
| 4193502 | |
| CC(C)(C)C(=O)NC1=CC=CC=C1B(O)O |
| C11H16BNO3 | |
| MFCD01114645 | |
| 2-tert-butylcarbonylamino phenylboronic acid, 2-pivalamidophenyl boronic acid, 2-pivalamido phenylboronic acid, 2-pivaloylamino phenylboronic acid, 2-2,2-dimethylpropanoylamino phenyl boronic acid, 2-pivaloylaminobenzene boronic acid, 2-2,2-dimethylpropanamido phenylboronic acid, 2-2,2,2-trimethylacetamido benzeneboronic acid, 2-2,2-dimethyl-propionylamino phenylboronic acid, boronic acid,b-2-2,2-dimethyl-1-oxopropyl amino phenyl | |
| [2-(2,2-dimethylpropanamido)phenyl]boronic acid |
Safety and Handling
TSCA : No