missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Hydroxy-4'-(2-hydroxyethoxy)-2-methylpropiophenone 98.0+%, TCI America™
Supplier: TCI America H1361100G
Specifications
| 2-Hydroxy-4′-(2-hydroxyethoxy)-2-methylpropiophenone | |
| 91°C | |
| C12H16O4 | |
| 100 g | |
| GJKGAPPUXSSCFI-UHFFFAOYSA-N | |
| 2-hydroxy-1-[4-(2-hydroxyethoxy)phenyl]-2-methylpropan-1-one | |
| 86266 | |
| ≥98.0% (HPLC) |
| 106797-53-9 | |
| White-Yellow | |
| MFCD00085267 | |
| 2-Hydroxy-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-1-propanone | |
| CC(C)(O)C(=O)C1=CC=C(OCCO)C=C1 | |
| 224.26 | |
| 224.26 | |
| Crystalline Powder |
Chemical Identifiers
| 106797-53-9 | |
| 224.26 | |
| GJKGAPPUXSSCFI-UHFFFAOYSA-N | |
| 86266 | |
| CC(C)(O)C(=O)C1=CC=C(OCCO)C=C1 |
| C12H16O4 | |
| MFCD00085267 | |
| 2-Hydroxy-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-1-propanone | |
| 2-hydroxy-1-[4-(2-hydroxyethoxy)phenyl]-2-methylpropan-1-one |
Safety and Handling
EINECSNumber : (3)-4272
RTECSNumber : UC2976000
TSCA : Yes