Learn More
2-Ethyl-1,3-hexanediol, 99%, mixture of isomers
CAS: 94-96-2 | C8H18O2 | 146.23 g/mol
Supplier: Thermo Scientific Chemicals 118512500
| Quantity | 250 mL |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| C8H18O2 | |
| MFCD00004578 | |
| 2-ethyl-1,3-hexanediol, ethohexadiol, 1,3-hexanediol, 2-ethyl, octylene glycol, ethyl hexanediol, carbide 6-12, repellent 612, rutgers 612, 6-12-insect repellent, diol-kyowa 8 | |
| CHEBI:34273 | |
| CCCC(O)C(CC)CO |
Specifications
| 2-Ethyl-1, 3-hexanediol | |
| 0.05mg KOH/g max. | |
| 98.5 | |
| -40°C | |
| 243°C | |
| Authentic | |
| Glass bottle | |
| 1.4495 to 1.4525 | |
| 250 mL | |
| 0.9422 | |
| 2-ethyl-1,3-hexanediol, ethohexadiol, 1,3-hexanediol, 2-ethyl, octylene glycol, ethyl hexanediol, carbide 6-12, repellent 612, rutgers 612, 6-12-insect repellent, diol-kyowa 8 | |
| RWLALWYNXFYRGW-UHFFFAOYNA-N | |
| 2-ethylhexane-1,3-diol | |
| 7211 | |
| CHEBI:34273 | |
| 99% |
| 99% | |
| 94-96-2 | |
| 100.0 | |
| 0.9422g/mL | |
| 136°C | |
| 98.5% min. (GC) | |
| C8H18O2 | |
| CH3CH2CH2CH(OH)CH(C2H5)CH2OH | |
| MFCD00004578 | |
| 15, 3797 | |
| Solubility in water: 42g/L (20°C). Other solubilities: soluble in ethanol,isopropanol,propylene glycol,,castor oil and ether | |
| CCCC(O)C(CC)CO | |
| 146.23 | |
| 323 mPa.s (20°C) | |
| 146.23 | |
| Liquid |
Safety and Handling
GHS H Statement
Causes serious eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Immediately
GHS Signal Word: Danger
EINECSNumber : 202-377-9
RTECSNumber : MO2625000
TSCA : TSCA