Learn More
2-Chloroquinoline, 98%
CAS: 612-62-4 | C9H6ClN | 163.61 g/mol
$611.09 - $611.09
Chemical Identifiers
| CAS | 612-62-4 |
|---|---|
| Molecular Formula | C9H6ClN |
| Molecular Weight (g/mol) | 163.61 |
| MDL Number | MFCD00006741 |
| InChI Key | OFUFXTHGZWIDDB-UHFFFAOYSA-N |
| Synonym | 2-chloro-quinoline, quinoline, 2-chloro, chloroquinoline, unii-ux7rin8gew, quinoline, chloro, ccris 3977, ux7rin8gew, chioroquinoline, 2-chloro quinoline, pubchem7580 |
| PubChem CID | 11928 |
| IUPAC Name | 2-chloroquinoline |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC110040250
|
Thermo Scientific Chemicals
110040250 |
25 g | Glass bottle |
Each for $611.09
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 612-62-4 | |
| 163.61 | |
| OFUFXTHGZWIDDB-UHFFFAOYSA-N | |
| 11928 | |
| C1=CC=C2C(=C1)C=CC(=N2)Cl |
| C9H6ClN | |
| MFCD00006741 | |
| 2-chloro-quinoline, quinoline, 2-chloro, chloroquinoline, unii-ux7rin8gew, quinoline, chloro, ccris 3977, ux7rin8gew, chioroquinoline, 2-chloro quinoline, pubchem7580 | |
| 2-chloroquinoline |
Specifications
| 612-62-4 | |
| 100.0 | |
| White to Yellow | |
| 265°C to 267°C | |
| Authentic | |
| Glass bottle | |
| MFCD00006741 | |
| 20, 359 | |
| 2-chloro-quinoline, quinoline, 2-chloro, chloroquinoline, unii-ux7rin8gew, quinoline, chloro, ccris 3977, ux7rin8gew, chioroquinoline, 2-chloro quinoline, pubchem7580 | |
| OFUFXTHGZWIDDB-UHFFFAOYSA-N | |
| 2-chloroquinoline | |
| 11928 | |
| 99% | |
| 2-Chloroquinoline |
| 98.5 | |
| 34°C to 37°C | |
| 1.2300g/mL | |
| >110°C | |
| 98.5% min. (GC) | |
| C9H6ClN | |
| 25 g | |
| 1.23 | |
| Solubility in water: insoluble. Other solubilities: soluble in ethanol,ether,benzene,petrol | |
| C1=CC=C2C(=C1)C=CC(=N2)Cl | |
| 163.61 | |
| 163.61 | |
| Crystalline Powder, Crystals and/or Chunks or Fused Mass |
Safety and Handling
GHS H Statement
Causes skin irritation.
May cause respiratory irritation.
Causes serious eye irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning
EINECSNumber : 210-317-8
RUO – Research Use Only