Learn More
2-Bromo-4'-phenylacetophenone, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 146350250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 2-Bromo-4'-phenylacetophenone | |
| 135-73-9 | |
| 100.0 | |
| 98% | |
| C14H11BrO | |
| MFCD00000202 | |
| 07, III, 2137 | |
| KGHGZRVXCKCJGX-UHFFFAOYSA-N | |
| 2-bromo-1-(4-phenylphenyl)ethanone | |
| 67282 | |
| 98% |
| 98% | |
| 97.5 | |
| Authentic | |
| Glass bottle | |
| C6H5C6H4COCH2Br | |
| 25g | |
| 2-bromo-4'-phenylacetophenone, 4-phenylphenacyl bromide, p-bromoacetylbiphenyl, p-phenylphenacyl bromide, bromomethyl p-biphenylyl ketone, ethanone, 1-1,1'-biphenyl-4-yl-2-bromo, 2-bromo-1-4-phenylphenyl ethan-1-one, acetophenone, 2-bromo-4'-phenyl, alpha-bromo-p-phenylacetophenone, omega-bromo-4-phenylacetophenone | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)CBr | |
| 275.13 | |
| 275.13 |
Chemical Identifiers
| 135-73-9 | |
| 275.13 | |
| KGHGZRVXCKCJGX-UHFFFAOYSA-N | |
| 67282 | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)CBr |
| C14H11BrO | |
| MFCD00000202 | |
| 2-bromo-4'-phenylacetophenone, 4-phenylphenacyl bromide, p-bromoacetylbiphenyl, p-phenylphenacyl bromide, bromomethyl p-biphenylyl ketone, ethanone, 1-1,1'-biphenyl-4-yl-2-bromo, 2-bromo-1-4-phenylphenyl ethan-1-one, acetophenone, 2-bromo-4'-phenyl, alpha-bromo-p-phenylacetophenone, omega-bromo-4-phenylacetophenone | |
| 2-bromo-1-(4-phenylphenyl)ethanone |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 205-217-6
TSCA : TSCA
RUO â Research Use Only