missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-Bromo-3-chloro-5-(trifluoromethyl)pyridine, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals BTB09453DA
Specifications
| 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine | |
| 96.5 | |
| 97% | |
| C6H2BrClF3N | |
| 1g | |
| SMTKGMYGLYWNDL-UHFFFAOYSA-N | |
| 2-bromo-3-chloro-5-(trifluoromethyl)pyridine | |
| 2736237 | |
| 97% |
| 75806-84-7 | |
| 100.0 | |
| Amber glass bottle | |
| MFCD00153072 | |
| 2-bromo-3-chloro-5-trifluoromethyl pyridine, librarion l938, abbypharma ap-13-5059, pyridine, 2-bromo-3-chloro-5-trifluoromethyl, pubchem3000, acmc-1bicf, ksc498c5d, buttpark 153\33-66, 2-bromo-3-chloro-5 trifluoromethyl pyridine | |
| C1=C(C=NC(=C1Cl)Br)C(F)(F)F | |
| 260.438 | |
| 260.44 |
Chemical Identifiers
| 75806-84-7 | |
| 260.438 | |
| SMTKGMYGLYWNDL-UHFFFAOYSA-N | |
| 2736237 | |
| C1=C(C=NC(=C1Cl)Br)C(F)(F)F |
| C6H2BrClF3N | |
| MFCD00153072 | |
| 2-bromo-3-chloro-5-trifluoromethyl pyridine, librarion l938, abbypharma ap-13-5059, pyridine, 2-bromo-3-chloro-5-trifluoromethyl, pubchem3000, acmc-1bicf, ksc498c5d, buttpark 153\33-66, 2-bromo-3-chloro-5 trifluoromethyl pyridine | |
| 2-bromo-3-chloro-5-(trifluoromethyl)pyridine |
Safety and Handling
GHS P Statement Causes skin irritation. Causes serious eye irritation.
GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. Take off contaminated clothing and wash before reuse. IF IN EYES: Rinse cautio
Warning