Learn More
2-Bromo-2',4'-dimethoxyacetophenone, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 190010010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 2-Bromo-2', 4'-dimethoxyacetophenone | |
| 60965-26-6 | |
| 100.0 | |
| 98% | |
| C10H11BrO3 | |
| MFCD00000197 | |
| 2-bromo-1-2,4-dimethoxyphenyl ethanone, 2-bromo-2',4'-dimethoxyacetophenone, 2,4-dimethoxyphenacyl bromide, 2-bromo-1-2',4'-dimethoxyphenyl ethanone, 2-bromo-1-2,4-dimethoxyphenyl ethan-1-one, ethanone, 2-bromo-1-2,4-dimethoxyphenyl, 2-bromo-2',4'-dimethoxyacetopheneone, 1-2,4-dimethoxyphenyl-2-bromoethan-1-one, pubchem13433, acmc-1ba4l | |
| PKVBZABQCCQHLD-UHFFFAOYSA-N | |
| 2-bromo-1-(2,4-dimethoxyphenyl)ethanone | |
| 98683 | |
| 98% |
| 98% | |
| 97.5 | |
| Authentic | |
| Glass bottle | |
| (CH3O)2C6H3COCH2Br | |
| 1g | |
| Solubility in water: insoluble | |
| COC1=CC(=C(C=C1)C(=O)CBr)OC | |
| 259.09 | |
| 259.09 |
Chemical Identifiers
| 60965-26-6 | |
| 259.09 | |
| PKVBZABQCCQHLD-UHFFFAOYSA-N | |
| 98683 | |
| COC1=CC(=C(C=C1)C(=O)CBr)OC |
| C10H11BrO3 | |
| MFCD00000197 | |
| 2-bromo-1-2,4-dimethoxyphenyl ethanone, 2-bromo-2',4'-dimethoxyacetophenone, 2,4-dimethoxyphenacyl bromide, 2-bromo-1-2',4'-dimethoxyphenyl ethanone, 2-bromo-1-2,4-dimethoxyphenyl ethan-1-one, ethanone, 2-bromo-1-2,4-dimethoxyphenyl, 2-bromo-2',4'-dimethoxyacetopheneone, 1-2,4-dimethoxyphenyl-2-bromoethan-1-one, pubchem13433, acmc-1ba4l | |
| 2-bromo-1-(2,4-dimethoxyphenyl)ethanone |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Danger
EINECSNumber : 262-542-6
TSCA : TSCA
RUO â Research Use Only