missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ 2',7'-Dichlorofluorescin Diacetate, Calbiochem™,
Cell-permeable fluorogenic probe that is useful for the detection of reactive oxygen species (ROS) and nitric oxide (·NO) and for the determination of the degree of overall oxidative stress
Supplier: MilliporeSigma™ 287810100MG
Specifications
| 2',7'-Dichlorofluorescin Diacetate | |
| C24H16Cl2O7 | |
| h2dcfda, 2-3,6-diacetoxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid, 2',7'-dichlorohydrofluorescein diacetate, 2,7-dichlorodihydrofluorescein diacetate, benzoic acid, 2-3,6-bis acetyloxy-2,7-dichloro-9h-xanthen-9-yl, 2-3,6-bis acetyloxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid, 2′,7′-dichlorofluorescin diacetate, 2′,7′-dichlorodihydrofluorescein diacetate, 2-3,6-diacetyloxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid | |
| PXEZTIWVRVSYOK-UHFFFAOYSA-N | |
| 2-(3,6-diacetyloxy-2,7-dichloro-9H-xanthen-9-yl)benzoic acid | |
| 77718 | |
| ≥94% | |
| Crystalline Solid |
| 4091-99-0 | |
| 100 mg | |
| Soluble in DSMO | |
| CC(=O)OC1=C(C=C2C(C3=CC(=C(C=C3OC2=C1)OC(=O)C)Cl)C4=CC=CC=C4C(=O)O)Cl | |
| 487.285 | |
| 487.3 | |
| HPLC |
Chemical Identifiers
| 4091-99-0 | |
| 487.285 | |
| h2dcfda, 2-3,6-diacetoxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid, 2',7'-dichlorohydrofluorescein diacetate, 2,7-dichlorodihydrofluorescein diacetate, benzoic acid, 2-3,6-bis acetyloxy-2,7-dichloro-9h-xanthen-9-yl, 2-3,6-bis acetyloxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid, 2′,7′-dichlorofluorescin diacetate, 2′,7′-dichlorodihydrofluorescein diacetate, 2-3,6-diacetyloxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid | |
| 2-(3,6-diacetyloxy-2,7-dichloro-9H-xanthen-9-yl)benzoic acid |
| C24H16Cl2O7 | |
| PXEZTIWVRVSYOK-UHFFFAOYSA-N | |
| 77718 | |
| CC(=O)OC1=C(C=C2C(C3=CC(=C(C=C3OC2=C1)OC(=O)C)Cl)C4=CC=CC=C4C(=O)O)Cl |
Safety and Handling
Recommended Storage : -20°C (-4°F)