missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,6-Dichloroindophenol sodium salt hydrate, Honeywell Fluka™
≥97.0% (calc. based on dry substance, AT)
$202.55 - $202.55
Chemical Identifiers
| CAS | 620-45-1 |
|---|---|
| Molecular Formula | C12H6Cl2NNaO2 |
| Molecular Weight (g/mol) | 290.07 |
| MDL Number | MFCD00150014 |
| InChI Key | FHLDWQLHDYCXKI-UHFFFAOYSA-M |
| Synonym | 2,6-dichloroindophenol sodium salt, 2,6-dichlorophenolindophenol sodium salt, tillman's reagent, tillman's reagenz, dichlorphenol-indophenolnatrium, 2,6-dichloroindophenol sodium, unii-kad7q8xo1y, sodium 2,6-dichloroindophenol, sodium 2,6-dichloroindophenolate, 2,6-dichloroindophenol, sodium salt |
| PubChem CID | 23697355 |
| ChEBI | CHEBI:948 |
| IUPAC Name | sodium;4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate |
| SMILES | [Na+].[O-]C1=C(Cl)C=C(C=C1Cl)N=C1C=CC(=O)C=C1 |
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Chemical Identifiers
| 620-45-1 | |
| 290.07 | |
| FHLDWQLHDYCXKI-UHFFFAOYSA-M | |
| 23697355 | |
| sodium;4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate |
| C12H6Cl2NNaO2 | |
| MFCD00150014 | |
| 2,6-dichloroindophenol sodium salt, 2,6-dichlorophenolindophenol sodium salt, tillman's reagent, tillman's reagenz, dichlorphenol-indophenolnatrium, 2,6-dichloroindophenol sodium, unii-kad7q8xo1y, sodium 2,6-dichloroindophenol, sodium 2,6-dichloroindophenolate, 2,6-dichloroindophenol, sodium salt | |
| CHEBI:948 | |
| [Na+].[O-]C1=C(Cl)C=C(C=C1Cl)N=C1C=CC(=O)C=C1 |
Specifications
| 620-45-1 | |
| MFCD00150014 | |
| NONH for all modes of transport | |
| 2,6-dichloroindophenol sodium salt, 2,6-dichlorophenolindophenol sodium salt, tillman's reagent, tillman's reagenz, dichlorphenol-indophenolnatrium, 2,6-dichloroindophenol sodium, unii-kad7q8xo1y, sodium 2,6-dichloroindophenol, sodium 2,6-dichloroindophenolate, 2,6-dichloroindophenol, sodium salt | |
| [Na+].[O-]C1=C(Cl)C=C(C=C1Cl)N=C1C=CC(=O)C=C1 | |
| 290.07 | |
| CHEBI:948 | |
| ≥97% (calculated based on dry substance, AT) |
| C12H6Cl2NNaO2 | |
| 5 g | |
| 3641229 | |
| FHLDWQLHDYCXKI-UHFFFAOYSA-M | |
| sodium;4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate | |
| 23697355 | |
| 290.08g/mol (anhydrous basis) | |
| 2,6-Dichloroindophenol sodium salt hydrate |
Safety and Handling
RTECSNumber : GU5495000