missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,6-Dichloroindophenol, sodium salt hydrate, 95%
CAS: 1266615-56-8 | C12H6Cl2NNaO2 | 290.07 g/mol
$58.14 - $382.21
Chemical Identifiers
| CAS | 1266615-56-8 |
|---|---|
| Molecular Formula | C12H6Cl2NNaO2 |
| Molecular Weight (g/mol) | 290.07 |
| MDL Number | MFCD00150014 |
| InChI Key | CVSUAFOWIXUYQA-UHFFFAOYSA-M |
| Synonym | Tillman's reagent hydrate |
| PubChem CID | 23696612 |
| SMILES | [Na+].[O-]C1=CC=C(C=C1)N=C1C=C(Cl)C(=O)C(Cl)=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC152870010
|
Thermo Scientific Chemicals
152870010 |
1 g | Glass bottle |
Each for $58.14
|
|
||||
|
AC152870100
|
Thermo Scientific Chemicals
152870100 |
10 g | Glass bottle |
Each for $238.23
|
|
||||
|
AC152870250
|
Thermo Scientific Chemicals
152870250 |
25 g | Glass bottle |
Each for $382.21
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1266615-56-8 | |
| 290.07 | |
| CVSUAFOWIXUYQA-UHFFFAOYSA-M | |
| 23696612 |
| C12H6Cl2NNaO2 | |
| MFCD00150014 | |
| Tillman's reagent hydrate | |
| [Na+].[O-]C1=CC=C(C=C1)N=C1C=C(Cl)C(=O)C(Cl)=C1 |
Specifications
| 1266615-56-8 | |
| C12H6Cl2NNaO2 | |
| Tillman's reagent hydrate | |
| CVSUAFOWIXUYQA-UHFFFAOYSA-M | |
| [Na+].[O-]C1=CC=C(C=C1)N=C1C=C(Cl)C(=O)C(Cl)=C1 | |
| 290.07 | |
| 14% max. (1 g, 120°C) | |
| ≥98% | |
| For determination of ascorbic acid: Passes Test | |
| 1 g | |
| 2, 6-Dichloroindophenol, sodium salt hydrate |
| 98+% | |
| MFCD00150014 | |
| Solubility in water: soluble. Other solubilities: freely soluble in alcohol | |
| Authentic | |
| sodium 4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]benzen-1-olate | |
| 23696612 | |
| 290.07 | |
| Glass bottle | |
| Dark Green | |
| Powder |
RUO – Research Use Only