missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,6-Dichloroindophenol, sodium salt hydrate, 90+%
CAS: 1266615-56-8 | C12H6Cl2NNaO2 | 290.07 g/mol
$116.89 - $414.83
Chemical Identifiers
| CAS | 1266615-56-8 |
|---|---|
| Molecular Formula | C12H6Cl2NNaO2 |
| Molecular Weight (g/mol) | 290.07 |
| MDL Number | MFCD00150014 |
| InChI Key | CVSUAFOWIXUYQA-UHFFFAOYSA-M |
| Synonym | 2,6-dichloroindophenol sodium salt dihydrate, 2,6-dichloro-4-4-hydroxyphenyl azamethylene cyclohexa-2,5-dien-1-one, oxamet hane, oxamethane, sodium salt, c12h6cl2no2.na.2h2o, 2,6-dichlorophenol-indophenol sodium salt dihydrate, sodium 4-3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene amino phenolate dihydrate, sodium 4-3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene amino benzenolate dihydrate |
| PubChem CID | 23696612 |
| IUPAC Name | sodium;4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate;dihydrate |
| SMILES | [Na+].[O-]C1=CC=C(C=C1)N=C1C=C(Cl)C(=O)C(Cl)=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC450700050
|
Thermo Scientific Chemicals
450700050 |
5 g | Glass bottle |
Each for $116.89
|
|
||||
|
AC450700250
|
Thermo Scientific Chemicals
450700250 |
25 g | Glass bottle |
Each for $414.83
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1266615-56-8 | |
| 290.07 | |
| CVSUAFOWIXUYQA-UHFFFAOYSA-M | |
| 23696612 | |
| [Na+].[O-]C1=CC=C(C=C1)N=C1C=C(Cl)C(=O)C(Cl)=C1 |
| C12H6Cl2NNaO2 | |
| MFCD00150014 | |
| 2,6-dichloroindophenol sodium salt dihydrate, 2,6-dichloro-4-4-hydroxyphenyl azamethylene cyclohexa-2,5-dien-1-one, oxamet hane, oxamethane, sodium salt, c12h6cl2no2.na.2h2o, 2,6-dichlorophenol-indophenol sodium salt dihydrate, sodium 4-3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene amino phenolate dihydrate, sodium 4-3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene amino benzenolate dihydrate | |
| sodium;4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate;dihydrate |
Specifications
| 1266615-56-8 | |
| Glass bottle | |
| MFCD00150014 | |
| 2,6-dichloroindophenol sodium salt dihydrate, 2,6-dichloro-4-4-hydroxyphenyl azamethylene cyclohexa-2,5-dien-1-one, oxamet hane, oxamethane, sodium salt, c12h6cl2no2.na.2h2o, 2,6-dichlorophenol-indophenol sodium salt dihydrate, sodium 4-3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene amino phenolate dihydrate, sodium 4-3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene amino benzenolate dihydrate | |
| CVSUAFOWIXUYQA-UHFFFAOYSA-M | |
| sodium;4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate;dihydrate | |
| 23696612 | |
| 90+% |
| 90+% | |
| C12H6Cl2NNaO2 | |
| 5 g | |
| Solubility in water: soluble. Other solubilities: freely soluble in alcohol | |
| [Na+].[O-]C1=CC=C(C=C1)N=C1C=C(Cl)C(=O)C(Cl)=C1 | |
| 290.07 | |
| 290.07 | |
| 2, 6-Dichloroindophenol, sodium salt hydrate |
RUO – Research Use Only