Learn More
2,6-Diaminopurine, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 295270050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 2, 6-Diaminopurine | |
| 1904-98-9 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| MFCD00071537 | |
| 15, 2987 | |
| Solubility in water: 2.38g/L water (20°C) | |
| C1=NC2=C(N1)C(=NC(=N2)N)N | |
| 150.14 | |
| CHEBI:40235 | |
| 98% |
| 98% | |
| 97.5 | |
| >110°C | |
| 97.5% min. (HPLC) | |
| C5H6N6 | |
| 5g | |
| 2,6-diaminopurine, 9h-purine-2,6-diamine, 2-aminoadenine, 1h-purine-2,6-diamine, 2,6-diamino-9h-purine, purine, 2,6-diamino, purine-2,6-diyldiamine, unii-49p95bau4z, ccris 923, purine-2,6-diamine | |
| MSSXOMSJDRHRMC-UHFFFAOYSA-N | |
| 7H-purine-2,6-diamine | |
| 30976 | |
| 150.14 |
Chemical Identifiers
| 1904-98-9 | |
| 150.14 | |
| MSSXOMSJDRHRMC-UHFFFAOYSA-N | |
| 30976 | |
| 7H-purine-2,6-diamine |
| C5H6N6 | |
| MFCD00071537 | |
| 2,6-diaminopurine, 9h-purine-2,6-diamine, 2-aminoadenine, 1h-purine-2,6-diamine, 2,6-diamino-9h-purine, purine, 2,6-diamino, purine-2,6-diyldiamine, unii-49p95bau4z, ccris 923, purine-2,6-diamine | |
| CHEBI:40235 | |
| C1=NC2=C(N1)C(=NC(=N2)N)N |
Safety and Handling
GHS H Statement:
Suspected of causing cancer.
GHS P Statement:
Use personal protective equipment as required.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Warning
EINECSNumber : 217-605-2
RUO â Research Use Only