Learn More
2,2,4,4,6,8,8-Heptamethylnonane, 98%
CAS: 4390-04-9 | C16H34 | 226.44 g/mol
$97.96 - $1492.41
Chemical Identifiers
| CAS | 4390-04-9 |
|---|---|
| Molecular Formula | C16H34 |
| Molecular Weight (g/mol) | 226.44 |
| MDL Number | MFCD00008856 |
| InChI Key | VCLJODPNBNEBKW-UHFFFAOYNA-N |
| Synonym | isocetane, nonane, 2,2,4,4,6,8,8-heptamethyl, cyprane, pubchem16042, acmc-2097fb, dsstox_cid_30668, dsstox_gsid_52101, ksc492g9j, 2,4,4,6,8,8-heptamethylnonane, nonane,2,4,4,6,8,8-heptamethyl |
| PubChem CID | 20414 |
| IUPAC Name | 2,2,4,4,6,8,8-heptamethylnonane |
| SMILES | CC(CC(C)(C)C)CC(C)(C)CC(C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC156250500
|
Thermo Scientific Chemicals
156250500 |
50 mL | Glass bottle |
Each for $97.96
|
|
||||
|
AC156252500
|
Thermo Scientific Chemicals
156252500 |
250 mL | Glass bottle |
Each for $351.93
|
|
||||
|
AC156250010
|
Thermo Scientific Chemicals
156250010 |
1 L | Glass Bottle |
Each for $1,492.41
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 4390-04-9 | |
| 226.44 | |
| VCLJODPNBNEBKW-UHFFFAOYNA-N | |
| 20414 | |
| CC(CC(C)(C)C)CC(C)(C)CC(C)(C)C |
| C16H34 | |
| MFCD00008856 | |
| isocetane, nonane, 2,2,4,4,6,8,8-heptamethyl, cyprane, pubchem16042, acmc-2097fb, dsstox_cid_30668, dsstox_gsid_52101, ksc492g9j, 2,4,4,6,8,8-heptamethylnonane, nonane,2,4,4,6,8,8-heptamethyl | |
| 2,2,4,4,6,8,8-heptamethylnonane |
Specifications
| 4390-04-9 | |
| 100.0 | |
| 0.7900g/mL | |
| 95°C | |
| 97.5% min. (GC) | |
| C16H34 | |
| (CH3)3CCH2CH(CH3)CH2C(CH3)2CH2C(CH3)3 | |
| 50 mL | |
| isocetane, nonane, 2,2,4,4,6,8,8-heptamethyl, cyprane, pubchem16042, acmc-2097fb, dsstox_cid_30668, dsstox_gsid_52101, ksc492g9j, 2,4,4,6,8,8-heptamethylnonane, nonane,2,4,4,6,8,8-heptamethyl | |
| VCLJODPNBNEBKW-UHFFFAOYNA-N | |
| 2,2,4,4,6,8,8-heptamethylnonane | |
| 20414 | |
| 98% | |
| 2,2,4,4,6,8,8-Heptamethylnonane |
| 97.5 | |
| Colorless | |
| 240.0°C | |
| Authentic | |
| Glass bottle | |
| 1.4380 to 1.4400 | |
| MFCD00008856 | |
| 0.79 | |
| Solubility in water: insoluble | |
| CC(CC(C)(C)C)CC(C)(C)CC(C)(C)C | |
| 226.44 | |
| 226.44 | |
| Liquid |
Safety and Handling
GHS H Statement
May be fatal if swallowed and enters airways.
Harmful if inhaled.
Harmful if swallowed.
May cause damage to organs.
Repeated exposure may cause skin dryness or cracking.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Do NOT induce vomiting.
I
GHS Signal Word: Danger
EINECSNumber : 224-506-8
RUO – Research Use Only