missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-{2-[(2-Bromo-6-chlorophenyl)amino]phenyl}acetic Acid, MilliporeSigma™ Supelco™
Supplier: Merck Emd Millipore 0045650MG
Specifications
| 127792-23-8 | |
| C14H11BrClNO2 | |
| MFCD19704935 | |
| Diclofenac impurity D (PhEur); 2-[(2-Bromo-6-chlorophenyl)amino]benzeneacetic acid | |
| OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Br | |
| 340.60 | |
| ≥98% (HPLC) |
| 50 mg | |
| C14H11BrClNO2 | |
| UN2811 - Class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all | |
| RABKUCPRNJPBRH-UHFFFAOYSA-N | |
| 2-{2-[(2-bromo-6-chlorophenyl)amino]phenyl}acetic acid | |
| 340.60 |
Chemical Identifiers
| 127792-23-8 | |
| 340.60 | |
| RABKUCPRNJPBRH-UHFFFAOYSA-N | |
| 2-{2-[(2-bromo-6-chlorophenyl)amino]phenyl}acetic acid |
| C14H11BrClNO2 | |
| MFCD19704935 | |
| Diclofenac impurity D (PhEur); 2-[(2-Bromo-6-chlorophenyl)amino]benzeneacetic acid | |
| OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Br |
Safety and Handling
H301 - H315 - H319 - H411
ShelfLife : Limited shelf life, expiry date on the label