Learn More
(1S)-(-)-Verbenone, 94%
CAS: 1196-01-6 | C10H14O | 150.22 g/mol
Supplier: Thermo Scientific Chemicals 203630100
| Quantity | 10 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1196-01-6 | |
| 150.22 | |
| DCSCXTJOXBUFGB-JGVFFNPUSA-N | |
| 92874 | |
| (1S,5S)-2,6,6-trimethylbicyclo[3.1.1]hept-2-en-4-one |
| C10H14O | |
| MFCD00001343 | |
| levoverbenone, --verbenone, l-verbenone, 1s---verbenone, --2-pinen-4-one, verbenone, unii-2xp0j7754u, 1s,5s-4,6,6-trimethylbicyclo 3.1.1 hept-3-en-2-one, verbenone, l, bicyclo 3.1.1 hept-3-en-2-one, 4,6,6-trimethyl-, 1s,5s | |
| CHEBI:78316 | |
| CC1=CC(=O)[C@H]2C[C@@H]1C2(C)C |
Specifications
| (1S)-(-)-Verbenone | |
| 1196-01-6 | |
| 0.9700g/mL | |
| 85°C | |
| 92% min. (GC) | |
| C10H14O | |
| 10 g | |
| 07, 161 | |
| − 220.00 (20.00°C c=3−4,CHCL3) | |
| levoverbenone, --verbenone, l-verbenone, 1s---verbenone, --2-pinen-4-one, verbenone, unii-2xp0j7754u, 1s,5s-4,6,6-trimethylbicyclo 3.1.1 hept-3-en-2-one, verbenone, l, bicyclo 3.1.1 hept-3-en-2-one, 4,6,6-trimethyl-, 1s,5s | |
| DCSCXTJOXBUFGB-JGVFFNPUSA-N | |
| (1S,5S)-2,6,6-trimethylbicyclo[3.1.1]hept-2-en-4-one | |
| 92874 | |
| 150.22 | |
| Liquid |
| 94% | |
| Yellow | |
| 227°C to 228°C | |
| Authentic | |
| Glass bottle | |
| 1.4950 to 1.497 | |
| MFCD00001343 | |
| 0.97 | |
| -220 | |
| Solubility in water: practically insoluble. Other solubilities: miscible with most common organic solvents | |
| CC1=CC(=O)[C@H]2C[C@@H]1C2(C)C | |
| 150.22 | |
| CHEBI:78316 | |
| 94% |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful if inhaled.
Causes skin irritation.
Causes serious eye irritation.
May cause an allergic skin reaction.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
IF ON SKIN:
GHS Signal Word: Warning
EINECSNumber : 214-807-2
TSCA : TSCA