Learn More
(1R)-(+)-alpha-Pinene, 98%, 80% ee
CAS: 7785-70-8 | C10H16 | 136.24 g/mol
Supplier: Thermo Scientific Chemicals 131261000
| Quantity | 100 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| C10H16 | |
| MFCD00001346 | |
| +-alpha-pinene, 1r,5r-2,6,6-trimethylbicyclo 3.1.1 hept-2-ene, 1r-+-alpha-pinene, 1r,5r-alpha-pinene, unii-h6cm4twh1w, +-pinene, h6cm4twh1w, 1r,5r-2-pinene, bicyclo 3.1.1 hept-2-ene, 2,6,6-trimethyl-, 1r,5r, +-pin-2 3-ene | |
| CHEBI:28261 |
Specifications
| (1R)-(+)-α-Pinene | |
| 7785-70-8 | |
| 100.0 | |
| Colorless | |
| 155.0°C | |
| 75% min. | |
| 97.5% min. (GC) | |
| C10H16 | |
| 100 g | |
| 05, 146 | |
| 0.86 | |
| +43.50° (20°C neat) | |
| + 43.50 | |
| GRWFGVWFFZKLTI-RKDXNWHRSA-N | |
| (1R,5R)-4,6,6-trimethylbicyclo[3.1.1]hept-3-ene | |
| 82227 | |
| 136.24 | |
| Liquid |
| 98% (80+% e.e.) | |
| 97.5 | |
| -62.0°C | |
| 0.8600g/mL | |
| 33°C | |
| Authentic | |
| Glass bottle | |
| 1.4650 to 1.4670 | |
| MFCD00001346 | |
| 15,201 | |
| 14, 7445 | |
| +-alpha-pinene, 1r,5r-2,6,6-trimethylbicyclo 3.1.1 hept-2-ene, 1r-+-alpha-pinene, 1r,5r-alpha-pinene, unii-h6cm4twh1w, +-pinene, h6cm4twh1w, 1r,5r-2-pinene, bicyclo 3.1.1 hept-2-ene, 2,6,6-trimethyl-, 1r,5r, +-pin-2 3-ene | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol,chloroform,diethyl ether | |
| CC1=CC[C@@H]2C[C@H]1C2(C)C | |
| 136.24 | |
| CHEBI:28261 | |
| 98%,80% ee |
Safety and Handling
GHS H Statement
Flammable liquid and vapor.
May cause an allergic skin reaction.
May be fatal if swallowed and enters airways.
Causes skin irritation.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Wear protective gloves/protective clothing.
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with water/shower.
GHS Signal Word: Danger
EINECSNumber : 232-087-8
TSCA : TSCA