missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1H,1H-Pentadecafluoro-n-octyl Acrylate (stabilized with MEHQ) 95.0+%, TCI America™
Supplier: TCI America P175425G
Specifications
| 1H,1H-Pentadecafluoro-n-octyl Acrylate (stabilized with MEHQ) | |
| Yellow | |
| C11H5F15O2 | |
| 25 g | |
| YSQGYEYXKXGAQA-UHFFFAOYSA-N | |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl prop-2-enoate | |
| 67551 | |
| ≥95.0% (GC) |
| 307-98-2 | |
| 65°C | |
| MFCD00039248 | |
| 1h,1h-pentadecafluorooctyl acrylate, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl acrylate, 1h,1h-perfluorooctyl acrylate, acrylic acid 1h,1h-pentadecafluoro-n-octyl ester, 2-propenoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl ester, 1h,1h-perfluoro-n-octyl acrylate, 1h,1h-pentadecafluoro-n-octyl acrylate, 1,1-dihydroperfluorooctyl acrylate, 1,1-dyhydroperfluorooctyl acrylate, acrylic acid 1h,1h-perfluorooctyl ester | |
| C=CC(=O)OCC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F | |
| 454.135 | |
| 454.14 | |
| Liquid |
Chemical Identifiers
| 307-98-2 | |
| 454.135 | |
| YSQGYEYXKXGAQA-UHFFFAOYSA-N | |
| 67551 | |
| C=CC(=O)OCC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| C11H5F15O2 | |
| MFCD00039248 | |
| 1h,1h-pentadecafluorooctyl acrylate, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl acrylate, 1h,1h-perfluorooctyl acrylate, acrylic acid 1h,1h-pentadecafluoro-n-octyl ester, 2-propenoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl ester, 1h,1h-perfluoro-n-octyl acrylate, 1h,1h-pentadecafluoro-n-octyl acrylate, 1,1-dihydroperfluorooctyl acrylate, 1,1-dyhydroperfluorooctyl acrylate, acrylic acid 1h,1h-perfluorooctyl ester | |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl prop-2-enoate |
Safety and Handling
TSCA : Yes