missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1H,1H,2H,2H-Tridecafluoro-n-octyl Methacrylate (stabilized with HQ + MEHQ) 98.0+%, TCI America™
Supplier: TCI America T341425G
Specifications
| 1H,1H,2H,2H-Tridecafluoro-n-octyl Methacrylate (stabilized with HQ + MEHQ) | |
| 92°C | |
| MFCD00077580 | |
| Methacrylic Acid 1H,1H,2H,2H-Tridecafluoro-n-octyl Ester, 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-n-octyl Methacrylate, Methacrylic Acid 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-n-octyl Ester | |
| CC(=C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | |
| 432.18 | |
| 432.18 | |
| Liquid |
| 2144-53-8 | |
| C12H9F13O2 | |
| 25 g | |
| CDXFIRXEAJABAZ-UHFFFAOYSA-N | |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-methylprop-2-enoate | |
| 75066 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 2144-53-8 | |
| 432.18 | |
| CDXFIRXEAJABAZ-UHFFFAOYSA-N | |
| 75066 | |
| CC(=C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| C12H9F13O2 | |
| MFCD00077580 | |
| Methacrylic Acid 1H,1H,2H,2H-Tridecafluoro-n-octyl Ester, 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-n-octyl Methacrylate, Methacrylic Acid 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-n-octyl Ester | |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-methylprop-2-enoate |
Safety and Handling
EINECSNumber : (2)-3492&(2)-4065
RTECSNumber : UD3580000
TSCA : Yes