missing translation for 'onlineSavingsMsg'
Learn More
Learn More
18-beta-Glycyrrhetinic acid, 98+%
CAS: 471-53-4 | C30H46O4 | 470.69 g/mol
Supplier: Thermo Scientific Chemicals 120150050
| Quantity | 5 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 471-53-4 | |
| 470.69 | |
| MPDGHEJMBKOTSU-YKLVYJNSSA-N | |
| 10114 | |
| (2S,4aS,6aR,6aS,6bR,8aR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid |
| C30H46O4 | |
| MFCD00003706,MFCD00066716 | |
| enoxolone, glycyrrhetinic acid, uralenic acid, glycyrrhetic acid, 18-beta-glycyrrhetinic acid, glycyrrhetin, arthrodont, jintan, 18beta-glycyrrhetinic acid, rhetinic acid | |
| CHEBI:30853 | |
| CC1(C)[C@@H](O)CC[C@@]2(C)[C@H]1CC[C@]1(C)[C@@H]2C(=O)C=C2[C@@H]3C[C@](C)(CC[C@]3(C)CC[C@@]12C)C(O)=O |
Specifications
| 18-β-Glycyrrhetinic acid | |
| 471-53-4 | |
| 100.0 | |
| White | |
| Authentic | |
| Glass bottle | |
| 5 g | |
| 15, 3644 | |
| + 165 | |
| MPDGHEJMBKOTSU-YKLVYJNSSA-N | |
| (2S,4aS,6aR,6aS,6bR,8aR,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid | |
| 10114 | |
| 470.69 | |
| 2% max. (HPLC) |
| 98+% | |
| 98.0 | |
| 292°C to 295°C | |
| 1% max. (105°C, 4 hrs) | |
| 98+% | |
| C30H46O4 | |
| MFCD00003706,MFCD00066716 | |
| +165° (20°C c=1,CHC3,on dry ba) | |
| enoxolone, glycyrrhetinic acid, uralenic acid, glycyrrhetic acid, 18-beta-glycyrrhetinic acid, glycyrrhetin, arthrodont, jintan, 18beta-glycyrrhetinic acid, rhetinic acid | |
| CC1(C)[C@@H](O)CC[C@@]2(C)[C@H]1CC[C@]1(C)[C@@H]2C(=O)C=C2[C@@H]3C[C@](C)(CC[C@]3(C)CC[C@@]12C)C(O)=O | |
| 470.69 | |
| CHEBI:30853 | |
| 98+% | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : 207-444-6
RTECSNumber : RK0180000
TSCA : TSCA