Learn More
1-Pentanesulfonic acid, sodium salt monohydrate, 98+%, HPLC grade
CAS: 207605-40-1 | C5H11NaO3S·H2O | 192.22 g/mol
$539.59 - $1616.94
Chemical Identifiers
| CAS | 207605-40-1 |
|---|---|
| Molecular Formula | C5H11NaO3S·H2O |
| Molecular Weight (g/mol) | 192.22 |
| MDL Number | MFCD00149548 |
| InChI Key | FPQYXAFKHLSWTI-UHFFFAOYSA-M |
| Synonym | sodium pentane-1-sulfonate hydrate, 1-pentanesulfonic acid sodium salt monohydrate, sodium 1-pentanesulfonate monohydrate, potassium hydrate pentane-1-sulfonate, sodium 1-pentanesulfonate hydrate, sodium hydrate pentane-1-sulfonate, sodium pentane-1-sulfonate-water 1/1/1, 1-pentane sulphonic acid sodium salt monohydrate, 1-pentanesulfonic acid sodium salt monohydydrate, sodium 1-pentanesulfonate monohydrate, hplc grade |
| PubChem CID | 23693099 |
| IUPAC Name | sodium;pentane-1-sulfonate;hydrate |
| SMILES | CCCCCS(=O)(=O)[O-].O.[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC423200250
|
Thermo Scientific Chemicals
423200250 |
25 g | Glass Bottle |
Each for $539.59
|
|
||||
|
AC423201000
|
Thermo Scientific Chemicals
423201000 |
100 g | Glass bottle |
Each for $1,616.94
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
For ion pair chromatographyChemical Identifiers
| 207605-40-1 | |
| 192.22 | |
| FPQYXAFKHLSWTI-UHFFFAOYSA-M | |
| 23693099 | |
| CCCCCS(=O)(=O)[O-].O.[Na+] |
| C5H11NaO3S·H2O | |
| MFCD00149548 | |
| sodium pentane-1-sulfonate hydrate, 1-pentanesulfonic acid sodium salt monohydrate, sodium 1-pentanesulfonate monohydrate, potassium hydrate pentane-1-sulfonate, sodium 1-pentanesulfonate hydrate, sodium hydrate pentane-1-sulfonate, sodium pentane-1-sulfonate-water 1/1/1, 1-pentane sulphonic acid sodium salt monohydrate, 1-pentanesulfonic acid sodium salt monohydydrate, sodium 1-pentanesulfonate monohydrate, hplc grade | |
| sodium;pentane-1-sulfonate;hydrate |
Specifications
| 207605-40-1 | |
| >300°C | |
| 98+% | |
| C5H11NaO3S·H2O | |
| MFCD00149548 | |
| 04, III, 23 | |
| Solubility in water: soluble | |
| CCCCCS(=O)(=O)[O-].O.[Na+] | |
| 192.22 | |
| 192.22 | |
| Liquid |
| (0.25M aq. soln.) (1 cm cell vs HPLC water), 0.05 max. at 220nm, 0.03 max. at 230nm, 0.02 max. at 240nm, 0.01 max. at 250nm, 0.01 max. at 260nm | |
| Authentic | |
| Glass Bottle | |
| CH3(CH2)4SO3Na·H2O | |
| 25 g | |
| sodium pentane-1-sulfonate hydrate, 1-pentanesulfonic acid sodium salt monohydrate, sodium 1-pentanesulfonate monohydrate, potassium hydrate pentane-1-sulfonate, sodium 1-pentanesulfonate hydrate, sodium hydrate pentane-1-sulfonate, sodium pentane-1-sulfonate-water 1/1/1, 1-pentane sulphonic acid sodium salt monohydrate, 1-pentanesulfonic acid sodium salt monohydydrate, sodium 1-pentanesulfonate monohydrate, hplc grade | |
| FPQYXAFKHLSWTI-UHFFFAOYSA-M | |
| sodium;pentane-1-sulfonate;hydrate | |
| 23693099 | |
| 98+% | |
| 1-Pentanesulfonic Acid, Sodium Salt Monohydrate |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
If eye irritation persists: Get medical advice/attention.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
Call a POISON CENTER
GHS Signal Word: Warning
EINECSNumber : 245-208-4
TSCA : TSCA
RUO – Research Use Only