Learn More
1-Naphthalenemethylamine, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 155580010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 1-Naphthalenemethylamine | |
| 96.0 | |
| 1.0730g/mL | |
| >110°C | |
| 96% min. (GC) | |
| C11H12N | |
| C10H7CH2NH2 | |
| 1g | |
| 1.073 | |
| Solubility in water: .. Other solubilities: soluble in ethanol,ether,carbon disulfide,sulfu,ric acid | |
| [NH3+]CC1=C2C=CC=CC2=CC=C1 | |
| 158.22 | |
| 157.21 |
| 118-31-0 | |
| 100.0 | |
| 290°C to 293°C | |
| Authentic | |
| Glass bottle | |
| 1.643 | |
| MFCD00004048 | |
| 12, 1316 | |
| 1-naphthalenemethylamine, 1-naphthalenemethanamine, 1-naphthylmethylamine, 1-aminomethyl naphthalene, 1-naphthalenemethyl amine, c-naphthalen-1-yl-methylamine, 1-naphthylmethanamine, 1-aminomethylnaphthalene, naphthylmethylamine, 1-naphthylmethyl amine hydrochloride | |
| NVSYANRBXPURRQ-UHFFFAOYSA-O | |
| naphthalen-1-ylmethanamine | |
| 8355 | |
| 97% |
Chemical Identifiers
| 118-31-0 | |
| 158.22 | |
| NVSYANRBXPURRQ-UHFFFAOYSA-O | |
| 8355 | |
| [NH3+]CC1=C2C=CC=CC2=CC=C1 |
| C11H12N | |
| MFCD00004048 | |
| 1-naphthalenemethylamine, 1-naphthalenemethanamine, 1-naphthylmethylamine, 1-aminomethyl naphthalene, 1-naphthalenemethyl amine, c-naphthalen-1-yl-methylamine, 1-naphthylmethanamine, 1-aminomethylnaphthalene, naphthylmethylamine, 1-naphthylmethyl amine hydrochloride | |
| naphthalen-1-ylmethanamine |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Immediately call a POISON CENTER or doctor/physician.
IF IN EYES: Rinse cautiously with
GHS Signal Word: Danger
EINECSNumber : 204-244-
RUO â Research Use Only