missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-methyl-1h-indazole-3-carbonyl chloride, 97%, Thermo Scientific™
$157.30 - $452.86
Chemical Identifiers
| CAS | 106649-02-9 |
|---|---|
| Molecular Formula | C9H7ClN2O |
| Molecular Weight (g/mol) | 194.62 |
| MDL Number | MFCD02093096 |
| InChI Key | NPNWVMBPSINFBV-UHFFFAOYSA-N |
| Synonym | 1-methyl-1h-indazole-3-carbonyl chloride, 1h-indazole-3-carbonylchloride, 1-methyl, 1-methyl-1h-indazol-3-carbonyl chloride, 1h-indazole-3-carbonyl chloride, 1-methyl, acmc-20mac8, 1-methyl-3-indazolylcarbonyl chloride, 1-methyl-indazole-3-carbonyl chloride, 1-methyl-1h-indazole-3-carboxychloride, 1-methyl-1h-indazole-3-carboxylic acid chloride |
| PubChem CID | 7022055 |
| IUPAC Name | 1-methylindazole-3-carbonyl chloride |
| SMILES | CN1N=C(C(Cl)=O)C2=CC=CC=C12 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
CC06302CB
|
Thermo Scientific Chemicals
CC06302CB |
250 mg | Amber Glass Bottle |
Each for $157.30
|
|
||||
|
CC06302DA
|
Thermo Scientific Chemicals
CC06302DA |
1 g | Amber Glass Bottle |
Each for $452.86
|
|
||||
Chemical Identifiers
| 106649-02-9 | |
| 194.62 | |
| NPNWVMBPSINFBV-UHFFFAOYSA-N | |
| 7022055 | |
| CN1N=C(C(Cl)=O)C2=CC=CC=C12 |
| C9H7ClN2O | |
| MFCD02093096 | |
| 1-methyl-1h-indazole-3-carbonyl chloride, 1h-indazole-3-carbonylchloride, 1-methyl, 1-methyl-1h-indazol-3-carbonyl chloride, 1h-indazole-3-carbonyl chloride, 1-methyl, acmc-20mac8, 1-methyl-3-indazolylcarbonyl chloride, 1-methyl-indazole-3-carbonyl chloride, 1-methyl-1h-indazole-3-carboxychloride, 1-methyl-1h-indazole-3-carboxylic acid chloride | |
| 1-methylindazole-3-carbonyl chloride |
Specifications
| 106649-02-9 | |
| Amber Glass Bottle | |
| MFCD02093096 | |
| 1-methyl-1h-indazole-3-carbonyl chloride, 1h-indazole-3-carbonylchloride, 1-methyl, 1-methyl-1h-indazol-3-carbonyl chloride, 1h-indazole-3-carbonyl chloride, 1-methyl, acmc-20mac8, 1-methyl-3-indazolylcarbonyl chloride, 1-methyl-indazole-3-carbonyl chloride, 1-methyl-1h-indazole-3-carboxychloride, 1-methyl-1h-indazole-3-carboxylic acid chloride | |
| CN1N=C(C(Cl)=O)C2=CC=CC=C12 | |
| 194.62 | |
| 194.62 | |
| 1-Methyl-1H-indazole-3-carbonyl chloride |
| 97% | |
| C9H7ClN2O | |
| 250 mg | |
| NPNWVMBPSINFBV-UHFFFAOYSA-N | |
| 1-methylindazole-3-carbonyl chloride | |
| 7022055 | |
| 97% |