missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-Decanesulfonic acid, sodium salt, 99+%, Ion pair chromatography, anhydrous
CAS: 13419-61-9 | C10H21NaO3S | 244.32 g/mol
Supplier: Thermo Scientific Chemicals 396710250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
For ion pair chromatographySpecifications
| 1-Decanesulfonic acid, sodium salt | |
| 13419-61-9 | |
| 0.02 max. (C=0.2 M in water, 40°C) at 230nm, 0.02 max. (C=0.2 M in water, 40°C) at 260nm, 0.03 max. (C=0.2 M in water, 40°C) at 220nm, 0.05 max. (C=0.2 M in water, 40°C) at 210nm | |
| >300.0°C | |
| 1% max. (150°C) | |
| 99+% | |
| C10H21NaO3S | |
| MFCD00007526 | |
| sodium decane-1-sulfonate, sodium 1-decanesulfonate, 1-decanesulfonic acid sodium salt, 1-decanesulfonic acid, sodium salt, decyl sodium sulfonate, sodium decane-1-sulphonate, ipc-alks-10, n-decylsulfonic acid, sodium salt, 1-decanesulphonic acid, sodium salt, 2-decanesulfonic acid, sodium salt | |
| AIMUHNZKNFEZSN-UHFFFAOYSA-M | |
| sodium;decane-1-sulfonate | |
| 2724181 | |
| 99+% | |
| Crystalline Powder |
| Anhydrous | |
| 99.0 | |
| 100.0 | |
| White | |
| Authentic | |
| Glass bottle | |
| CH3(CH2)9SO3Na | |
| 25 g | |
| Solubility in water: soluble | |
| CCCCCCCCCCS(=O)(=O)[O-].[Na+] | |
| 244.32 | |
| 244.32 | |
| Ion Pair Chromatography |
Chemical Identifiers
| 13419-61-9 | |
| 244.32 | |
| AIMUHNZKNFEZSN-UHFFFAOYSA-M | |
| 2724181 | |
| CCCCCCCCCCS(=O)(=O)[O-].[Na+] |
| C10H21NaO3S | |
| MFCD00007526 | |
| sodium decane-1-sulfonate, sodium 1-decanesulfonate, 1-decanesulfonic acid sodium salt, 1-decanesulfonic acid, sodium salt, decyl sodium sulfonate, sodium decane-1-sulphonate, ipc-alks-10, n-decylsulfonic acid, sodium salt, 1-decanesulphonic acid, sodium salt, 2-decanesulfonic acid, sodium salt | |
| sodium;decane-1-sulfonate |
Safety and Handling
EINECSNumber : 236-525-9
RUO – Research Use Only