Learn More
1-Decanesulfonic acid, sodium salt, 96%, Thermo Scientific™
1-Decanesulfonic acid, sodium salt, 96%, ACROS Organics, Quantity: 25g, Packaging: Glass bottle, White to Cream, Melting Point: >300 deg.C, Molecular Weight: 244.32, Percent Purity: 96%, Assay Percent Range: 96%, Beilstein: 04, III, 27, CAS: 13419-61-9, CAS Max %: 100.0, CAS Min %: 95.0
Supplier: Thermo Scientific Chemicals 369450050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 1-Decanesulfonic acid, sodium salt | |
| 13419-61-9 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| CH3(CH2)9SO3Na | |
| 5g | |
| sodium decane-1-sulfonate, sodium 1-decanesulfonate, 1-decanesulfonic acid sodium salt, 1-decanesulfonic acid, sodium salt, decyl sodium sulfonate, sodium decane-1-sulphonate, ipc-alks-10, n-decylsulfonic acid, sodium salt, 1-decanesulphonic acid, sodium salt, 2-decanesulfonic acid, sodium salt | |
| AIMUHNZKNFEZSN-UHFFFAOYSA-M | |
| sodium;decane-1-sulfonate | |
| 2724181 | |
| 96% |
| 96% | |
| 95.0 | |
| 5% max. (100°C, 3 hrs) (vacuum) | |
| 96% | |
| C10H21NaO3S | |
| MFCD00007526 | |
| 04, III, 27 | |
| Solubility in water: soluble | |
| CCCCCCCCCCS(=O)(=O)[O-].[Na+] | |
| 244.32 | |
| 244.32 |
Safety and Handling
EINECSNumber : 236-525-9
RUO â Research Use Only