Learn More
1-Chloro-3,4-dinitrobenzene, 90%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 172311000
Specifications
| 1-Chloro-3,4-dinitrobenzene | |
| 88.0 | |
| 1.6800g/mL | |
| 194°C | |
| 88% min. (GC) | |
| C6H3ClN2O4 | |
| ClC6H3(NO2)2 | |
| 05,262 | |
| 1-chloro-3,4-dinitrobenzene, 3,4-dinitrochlorobenzene, benzene, 4-chloro-1,2-dinitro, unii-z29b1f274e, 1,2-dinitro-4-chlorobenzene, 1,2-dino2 4-cl benzene, 4-chlordinitrobenzol, acmc-209mog, 4-chloro-1,2-dinitrobenzen, ghl.pd_mitscher_leg0.928 | |
| QVQSOXMXXFZAKU-UHFFFAOYSA-N | |
| 4-chloro-1,2-dinitrobenzene | |
| 33097 | |
| 90% |
| 610-40-2 | |
| 100.0 | |
| 315.0°C | |
| Authentic | |
| Glass bottle | |
| 1.5865 to 1.5885 (20°C, 589nm) | |
| 100g | |
| 1.68 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol and ether | |
| C1=CC(=C(C=C1Cl)[N+](=O)[O-])[N+](=O)[O-] | |
| 202.55 | |
| 202.55 |
Chemical Identifiers
| 610-40-2 | |
| 202.55 | |
| 1-chloro-3,4-dinitrobenzene, 3,4-dinitrochlorobenzene, benzene, 4-chloro-1,2-dinitro, unii-z29b1f274e, 1,2-dinitro-4-chlorobenzene, 1,2-dino2 4-cl benzene, 4-chlordinitrobenzol, acmc-209mog, 4-chloro-1,2-dinitrobenzen, ghl.pd_mitscher_leg0.928 | |
| 4-chloro-1,2-dinitrobenzene |
| C6H3ClN2O4 | |
| QVQSOXMXXFZAKU-UHFFFAOYSA-N | |
| 33097 | |
| C1=CC(=C(C=C1Cl)[N+](=O)[O-])[N+](=O)[O-] |
Safety and Handling
GHS H Statement
Toxic in contact with skin.
Toxic if inhaled.
Toxic if swallowed.
May cause damage to organs through prolonged or repeated exposure.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN:
GHS Signal Word: Danger
EINECSNumber : 210-223-7
RUO â Research Use Only