Learn More
1-Butyl-3-methylimidazolium hexafluorophosphate, 98+%
CAS: 174501-64-5 | C8H15F6N2P | 284.19 g/mol
$304.94 - $304.94
Chemical Identifiers
| CAS | 174501-64-5 |
|---|---|
| Molecular Formula | C8H15F6N2P |
| Molecular Weight (g/mol) | 284.19 |
| MDL Number | MFCD03093295 |
| InChI Key | IXQYBUDWDLYNMA-UHFFFAOYSA-N |
| Synonym | 1-butyl-3-methylimidazolium hexafluorophosphate, 1-butyl-3-methyl-1h-imidazol-3-ium hexafluorophosphate v, unii-zge3n4o8q9, 1-butyl-3-methylimidazoliumhexafluorophosphate, 1-n-butyl-3-methylimidazolium hexafluorophosphate, zge3n4o8q9, butylmethylimidazolium hexafluorophosphate, 1-methyl-3-butylimidazolium hexafluorophosphate, bmim pf6, c4mim hexafluorophosphate |
| PubChem CID | 2734174 |
| SMILES | F[P-](F)(F)(F)(F)F.CCCCN1C=C[N+](C)=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC354170250
|
Thermo Scientific Chemicals
354170250 |
25 g | Glass bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Ionic liquidChemical Identifiers
| 174501-64-5 | |
| 284.19 | |
| IXQYBUDWDLYNMA-UHFFFAOYSA-N | |
| 2734174 |
| C8H15F6N2P | |
| MFCD03093295 | |
| 1-butyl-3-methylimidazolium hexafluorophosphate, 1-butyl-3-methyl-1h-imidazol-3-ium hexafluorophosphate v, unii-zge3n4o8q9, 1-butyl-3-methylimidazoliumhexafluorophosphate, 1-n-butyl-3-methylimidazolium hexafluorophosphate, zge3n4o8q9, butylmethylimidazolium hexafluorophosphate, 1-methyl-3-butylimidazolium hexafluorophosphate, bmim pf6, c4mim hexafluorophosphate | |
| F[P-](F)(F)(F)(F)F.CCCCN1C=C[N+](C)=C1 |
Specifications
| 174501-64-5 | |
| 100.0 | |
| Colorless to Yellow | |
| >340.0°C | |
| 98% min. (HPLC) | |
| C8H15F6N2P | |
| 25 g | |
| 15,1584 | |
| IXQYBUDWDLYNMA-UHFFFAOYSA-N | |
| 1-butyl-3-methylimidazol-3-ium;hexafluorophosphate | |
| 2734174 | |
| 284.18 | |
| Viscous Liquid |
| 98.0 | |
| 6.5°C | |
| 1.3727g/mL | |
| Authentic | |
| Glass bottle | |
| MFCD03093295 | |
| 1.3727 | |
| 1-butyl-3-methylimidazolium hexafluorophosphate, 1-butyl-3-methyl-1h-imidazol-3-ium hexafluorophosphate v, unii-zge3n4o8q9, 1-butyl-3-methylimidazoliumhexafluorophosphate, 1-n-butyl-3-methylimidazolium hexafluorophosphate, zge3n4o8q9, butylmethylimidazolium hexafluorophosphate, 1-methyl-3-butylimidazolium hexafluorophosphate, bmim pf6, c4mim hexafluorophosphate | |
| F[P-](F)(F)(F)(F)F.CCCCN1C=C[N+](C)=C1 | |
| 284.19 | |
| 272.1 mPa.s (25°C) | |
| 98+% | |
| 1-Butyl-3-methylimidazolium hexafluorophosphate |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/e
GHS Signal Word: Warning
RUO – Research Use Only