Learn More
1,8-Dihydroxyanthraquinone, 95%
CAS: 117-10-2 | C14H8O4 | 240.21 g/mol
Supplier: Thermo Scientific Chemicals 114830050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1, 8-Dihydroxyanthraquinone | |
| 117-10-2 | |
| 100.0 | |
| Brown or Brown-Orange | |
| Authentic | |
| Glass bottle | |
| MFCD00001211 | |
| 08, 458 | |
| danthron, 1,8-dihydroxyanthraquinone, chrysazin, dantron, antrapurol, laxanthreen, diaquone, istizin, laxanorm, altan | |
| QBPFLULOKWLNNW-UHFFFAOYSA-N | |
| 1,8-dihydroxyanthracene-9,10-dione | |
| 2950 | |
| 240.21 | |
| Powder |
| 90-95% | |
| 90.0 | |
| 190.0°C to 195.0°C | |
| >200°C | |
| 94% min. (HPLC) | |
| C14H8O4 | |
| 5 g | |
| 15, 2814 | |
| Solubility in water: insoluble. Other solubilities: almost insoluble in alcohol,moderately soluble in ether,chloroform,soluble in 10 parts hot glacial acetic acid | |
| C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=CC=C3O | |
| 240.21 | |
| CHEBI:3682 | |
| 95% |
Chemical Identifiers
| 117-10-2 | |
| 240.21 | |
| QBPFLULOKWLNNW-UHFFFAOYSA-N | |
| 2950 | |
| 1,8-dihydroxyanthracene-9,10-dione |
| C14H8O4 | |
| MFCD00001211 | |
| danthron, 1,8-dihydroxyanthraquinone, chrysazin, dantron, antrapurol, laxanthreen, diaquone, istizin, laxanorm, altan | |
| CHEBI:3682 | |
| C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=CC=C3O |
Safety and Handling
GHS H Statement
Suspected of causing cancer.
Causes serious eye irritation.
GHS P Statement
Use personal protective equipment as required.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
GHS Signal Word: Warning
EINECSNumber : 204-173-5
RTECSNumber : CB6650000
TSCA : TSCA
RUO – Research Use Only