Learn More
1,3-Dimethyl-5-aminoadamantane hydrochloride, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 298080100
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 1, 3-Dimethyl-5-aminoadamantane hydrochloride | |
| Authentic | |
| Glass bottle | |
| MFCD00214336 | |
| 15,5897 | |
| Solubility in water: soluble | |
| [H+].[Cl-].CC12CC3CC(C)(C1)CC(N)(C3)C2 | |
| 215.77 | |
| CHEBI:64323 | |
| 99% |
| 41100-52-1 | |
| 99% | |
| C12H22ClN | |
| 10g | |
| memantine hydrochloride, memantine hcl, 3,5-dimethyladamantan-1-amine hydrochloride, 3,5-dimethyl-1-adamantanamine hydrochloride, namenda, akatinol, axura, namenda xr, memantine.hcl | |
| LDDHMLJTFXJGPI-UHFFFAOYNA-N | |
| 3,5-dimethyladamantan-1-amine;hydrochloride | |
| 181458 | |
| 215.77 |
Chemical Identifiers
| 41100-52-1 | |
| 215.77 | |
| LDDHMLJTFXJGPI-UHFFFAOYNA-N | |
| 181458 | |
| 3,5-dimethyladamantan-1-amine;hydrochloride |
| C12H22ClN | |
| MFCD00214336 | |
| memantine hydrochloride, memantine hcl, 3,5-dimethyladamantan-1-amine hydrochloride, 3,5-dimethyl-1-adamantanamine hydrochloride, namenda, akatinol, axura, namenda xr, memantine.hcl | |
| CHEBI:64323 | |
| [H+].[Cl-].CC12CC3CC(C)(C1)CC(N)(C3)C2 |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation occurs: Get medical advice/attention.
If eye irritation persists: Get medical advice/attention.
Wear protective gloves/protective clothing/eye protec
GHS Signal Word: Warning
EINECSNumber : 255-219-6
RUO â Research Use Only