missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1,3-Diacetylbenzene, 99%, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals 170090050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1, 3-Diacetylbenzene | |
| 6781-42-6 | |
| 100.0 | |
| Yellow | |
| >110°C | |
| 98.5% min. (GC) | |
| C10H10O2 | |
| C6H4(COCH3)2 | |
| 5 g | |
| VCHOFVSNWYPAEF-UHFFFAOYSA-N | |
| 1-(3-acetylphenyl)ethanone | |
| 23229 | |
| 99% |
| 99% | |
| 98.5 | |
| 35.0°C to 37.0°C | |
| 150.0°C to 155.0°C (15.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.5485 to 1.5505 | |
| MFCD00008740 | |
| 1,3-diacetylbenzene, 1,1'-1,3-phenylene diethanone, ethanone, 1,1'-1,3-phenylene bis, m-diacetylbenzene, benzene-1,3-bis acetyl, m-acetylacetophenone, m-acetyl acetophenone, 1-3-acetylphenyl ethanone, 1-3-acetylphenyl ethan-1-one, m-diacetyl benzene | |
| CC(=O)C1=CC(=CC=C1)C(C)=O | |
| 162.19 | |
| 162.19 | |
| Liquid After Melting |
Chemical Identifiers
| 6781-42-6 | |
| 162.19 | |
| VCHOFVSNWYPAEF-UHFFFAOYSA-N | |
| 23229 | |
| CC(=O)C1=CC(=CC=C1)C(C)=O |
| C10H10O2 | |
| MFCD00008740 | |
| 1,3-diacetylbenzene, 1,1'-1,3-phenylene diethanone, ethanone, 1,1'-1,3-phenylene bis, m-diacetylbenzene, benzene-1,3-bis acetyl, m-acetylacetophenone, m-acetyl acetophenone, 1-3-acetylphenyl ethanone, 1-3-acetylphenyl ethan-1-one, m-diacetyl benzene | |
| 1-(3-acetylphenyl)ethanone |
Safety and Handling
EINECSNumber : 229-842-9
TSCA : TSCA
RUO – Research Use Only