Learn More
1,2-Bis(chlorodimethylsilyl)ethane, 96%
CAS: 13528-93-3 | C6H16Cl2Si2 | 215.26 g/mol
$163.96 - $163.96
Chemical Identifiers
| CAS | 13528-93-3 |
|---|---|
| Molecular Formula | C6H16Cl2Si2 |
| Molecular Weight (g/mol) | 215.26 |
| MDL Number | MFCD00000505 |
| InChI Key | VGQOKOYKFDUPPJ-UHFFFAOYSA-N |
| Synonym | 1,2-bis chlorodimethylsilyl ethane, ethylenebis chlorodimethylsilane, silane, 1,2-ethanediylbis chlorodimethyl, unii-b4ocj0e6j1, 1,1,4,4-tetramethyl-1,4-dichlorodisilethylene, chloro 2-chlorodimethylsilyl ethyl dimethylsilane, b4ocj0e6j1, 2,5-dichloro-2,5-dimethyl-2,5-disilahexane, 1,1,4,4-tetramethyl-1,4-dichloro-disylethylene |
| PubChem CID | 83552 |
| IUPAC Name | chloro-[2-[chloro(dimethyl)silyl]ethyl]-dimethylsilane |
| SMILES | C[Si](C)(Cl)CC[Si](C)(C)Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC313260250
|
Thermo Scientific Chemicals
313260250 |
25 g | Glass bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 13528-93-3 | |
| 215.26 | |
| VGQOKOYKFDUPPJ-UHFFFAOYSA-N | |
| 83552 | |
| C[Si](C)(Cl)CC[Si](C)(C)Cl |
| C6H16Cl2Si2 | |
| MFCD00000505 | |
| 1,2-bis chlorodimethylsilyl ethane, ethylenebis chlorodimethylsilane, silane, 1,2-ethanediylbis chlorodimethyl, unii-b4ocj0e6j1, 1,1,4,4-tetramethyl-1,4-dichlorodisilethylene, chloro 2-chlorodimethylsilyl ethyl dimethylsilane, b4ocj0e6j1, 2,5-dichloro-2,5-dimethyl-2,5-disilahexane, 1,1,4,4-tetramethyl-1,4-dichloro-disylethylene | |
| chloro-[2-[chloro(dimethyl)silyl]ethyl]-dimethylsilane |
Specifications
| 13528-93-3 | |
| 100.0 | |
| 198.0°C to 200.0°C | |
| Authentic | |
| Glass bottle | |
| [-CH2Si(CH3)2Cl]2 | |
| 25 g | |
| 1,2-bis chlorodimethylsilyl ethane, ethylenebis chlorodimethylsilane, silane, 1,2-ethanediylbis chlorodimethyl, unii-b4ocj0e6j1, 1,1,4,4-tetramethyl-1,4-dichlorodisilethylene, chloro 2-chlorodimethylsilyl ethyl dimethylsilane, b4ocj0e6j1, 2,5-dichloro-2,5-dimethyl-2,5-disilahexane, 1,1,4,4-tetramethyl-1,4-dichloro-disylethylene | |
| VGQOKOYKFDUPPJ-UHFFFAOYSA-N | |
| chloro-[2-[chloro(dimethyl)silyl]ethyl]-dimethylsilane | |
| 83552 | |
| 96% | |
| 1, 2-Bis(chlorodimethylsilyl)ethane, 96% |
| 95.0 | |
| 35.0°C to 38.0°C | |
| 65°C | |
| 96% | |
| C6H16Cl2Si2 | |
| MFCD00000505 | |
| 15, 1251 | |
| Solubility in water: reacts. | |
| C[Si](C)(Cl)CC[Si](C)(C)Cl | |
| 215.26 | |
| 215.27 | |
| Low Melting Solid |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 236-871-0
TSCA : TSCA
RUO – Research Use Only