missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-(2,4-Dimethylphenyl)piperazine, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 136940050
| Quantity | 5g |
|---|---|
| Packaging | Glass bottle |
Description
Chemical Identifiers
| C12H18N2 | |
| MFCD00023127 | |
| 1-2,4-dimethylphenyl piperazine, 1-2,4-xylyl piperazine, piperazine, 1-2,4-dimethylphenyl, 2,4-dimethylphenyl piperazine, 1-2,4-dimethylphenyl piperazin, pubchem8588, akos bb-5739, timtec-bb sbb003650, 4-dimethylphenyl piperazine, acmc-2097uz | |
| 1-(2,4-dimethylphenyl)piperazine |
Specifications
| 1-(2, 4-Dimethylphenyl)piperazine | |
| 1013-76-9 | |
| 100.0 | |
| 98.5% min. (GC) | |
| C12H18N2 | |
| 5g | |
| 1-2,4-dimethylphenyl piperazine, 1-2,4-xylyl piperazine, piperazine, 1-2,4-dimethylphenyl, 2,4-dimethylphenyl piperazine, 1-2,4-dimethylphenyl piperazin, pubchem8588, akos bb-5739, timtec-bb sbb003650, 4-dimethylphenyl piperazine, acmc-2097uz | |
| CC1=CC(=C(C=C1)N2CCNCC2)C | |
| 190.29 | |
| 190.29 |
| 99% | |
| 98.5 | |
| Authentic | |
| Glass bottle | |
| 1.5530 to 1.555 | |
| MFCD00023127 | |
| RUIMBVCRNZHCRQ-UHFFFAOYSA-N | |
| 1-(2,4-dimethylphenyl)piperazine | |
| 70544 | |
| 99% |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Do not breathe dust/fume/gas/mist/vapors/spray.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present a
GHS Signal Word: Danger
EINECSNumber : 213-797-7