missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1,10-Phenanthroline, Monohydrate, ACS Grade, LabChem™
Supplier: LabChem LC181407
Specifications
| 1,10-Phenanthroline | |
| 5144-89-8 | |
| Carbon dioxide; Carbon monoxide; Nitrogen oxides | |
| White | |
| Amber Glass | |
| C12H8N2·H2O | |
| 5 g | |
| 1,10-phenanthroline hydrate, 1,10-phenanthroline monohydrate, o-phenanthroline monohydrate, unii-ksx215x00e, 1,10-fenantrolina, 4,5-phenanthroline monohydrate, 1,10-phenanthroline, monohydrate, 1,10-fenanthrolin, 1,10-phenanthrolineo-phenanthroline, 1, 10-phenanthroline monohydrate | |
| PPQJCISYYXZCAE-UHFFFAOYSA-N | |
| 1,10-phenanthroline hydrate | |
| 21226 | |
| ACS |
| Monohydrate | |
| 100 | |
| 93°C | |
| 1,100kg/m3 | |
| C12H10N2O | |
| MFCD00149973 | |
| 1100kg/m3 | |
| Soluble in water | |
| O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 | |
| 198.23 | |
| 198.22 | |
| Crystalline Powder |
Chemical Identifiers
| 5144-89-8 | |
| 198.23 | |
| PPQJCISYYXZCAE-UHFFFAOYSA-N | |
| 21226 | |
| O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 |
| C12H10N2O | |
| MFCD00149973 | |
| 1,10-phenanthroline hydrate, 1,10-phenanthroline monohydrate, o-phenanthroline monohydrate, unii-ksx215x00e, 1,10-fenantrolina, 4,5-phenanthroline monohydrate, 1,10-phenanthroline, monohydrate, 1,10-fenanthrolin, 1,10-phenanthrolineo-phenanthroline, 1, 10-phenanthroline monohydrate | |
| 1,10-phenanthroline hydrate |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Wash exposed skin thoroughly after handling.
Do not eat, drink or smoke when using this product.
If swallowed: Rinse mouth.
Immediately call a poison center/doctor.
Avoid release to the environment.
Collect spillage.
Dispose of contents/container to comply with local, state and federal regulations.
Danger
EINECSNumber : 200-629-2
Recommended Storage : Room Temperature