Learn More
1,1'-Diethyl-2,2'-cyanine iodide, 99%
CAS: 977-96-8 | C23H23IN2 | 454.34 g/mol
Supplier: Thermo Scientific Chemicals 407255000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1,1′-Diethyl-2,2′-cyanine iodide | |
| 977-96-8 | |
| 100.0 | |
| Red to Yellow | |
| 99% | |
| C23H23IN2 | |
| 500 mg | |
| decynium 22 | |
| CCN1C(=CC2=[N+](C3=CC=CC=C3C=C2)CC)C=CC4=CC=CC=C41.[I-] | |
| 454.34 | |
| CHEBI:37993 | |
| 99% |
| 99% | |
| 98.5 | |
| 273°C | |
| Authentic | |
| Glass bottle | |
| MFCD00011971 | |
| 23, II, 267 | |
| GMYRVMSXMHEDTL-UHFFFAOYSA-M | |
| (2Z)-1-ethyl-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]quinoline;iodide | |
| 71299759 | |
| 454.34 | |
| Crystalline Powder |
Chemical Identifiers
| 977-96-8 | |
| 454.34 | |
| GMYRVMSXMHEDTL-UHFFFAOYSA-M | |
| 71299759 | |
| (2Z)-1-ethyl-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]quinoline;iodide |
| C23H23IN2 | |
| MFCD00011971 | |
| decynium 22 | |
| CHEBI:37993 | |
| CCN1C(=CC2=[N+](C3=CC=CC=C3C=C2)CC)C=CC4=CC=CC=C41.[I-] |
Safety and Handling
GHS H Statement
Fatal if swallowed.
Harmful in contact with skin.
Fatal if inhaled.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN:
GHS Signal Word: Danger
EINECSNumber : 213-556-6
RUO – Research Use Only