missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1,1,1-Trichloro-2-methyl-2-propanol hemihydrate, 98%
CAS: 6001-64-5 | 0·5 H2O | 186.47 g/mol
$281.94 - $281.94
Chemical Identifiers
| CAS | 6001-64-5 |
|---|---|
| Molecular Formula | 0·5 H2O |
| Molecular Weight (g/mol) | 186.47 |
| MDL Number | MFCD02179352 |
| InChI Key | HBARVHNVVKZUGS-UHFFFAOYSA-N |
| Synonym | c4h7cl3o.1/2h2o, 1,1,1-trichloro-2-methyl-2-propanol hemihydrate, chlorobutanol hydrogen ion hydrate |
| PubChem CID | 102594540 |
| IUPAC Name | molecular hydrogen;1,1,1-trichloro-2-methylpropan-2-ol;hydrate |
| SMILES | [HH].CC(C)(C(Cl)(Cl)Cl)O.O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC150305000
|
Thermo Scientific Chemicals
150305000 |
500 g | Plastic bottle |
Each for $281.94
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 6001-64-5 | |
| 186.47 | |
| HBARVHNVVKZUGS-UHFFFAOYSA-N | |
| 102594540 | |
| [HH].CC(C)(C(Cl)(Cl)Cl)O.O |
| 0·5 H2O | |
| MFCD02179352 | |
| c4h7cl3o.1/2h2o, 1,1,1-trichloro-2-methyl-2-propanol hemihydrate, chlorobutanol hydrogen ion hydrate | |
| molecular hydrogen;1,1,1-trichloro-2-methylpropan-2-ol;hydrate |
Specifications
| 6001-64-5 | |
| 100.0 | |
| White | |
| 100°C | |
| 97.5 to 102.5% (ex Cl) (Argentometry) | |
| 0·5 H2O | |
| MFCD02179352 | |
| c4h7cl3o.1/2h2o, 1,1,1-trichloro-2-methyl-2-propanol hemihydrate, chlorobutanol hydrogen ion hydrate | |
| HBARVHNVVKZUGS-UHFFFAOYSA-N | |
| molecular hydrogen;1,1,1-trichloro-2-methylpropan-2-ol;hydrate | |
| 102594540 | |
| 98% | |
| 1, 1, 1-Trichloro-2-methyl-2-propanol hemihydrate, 98% |
| 97.5 | |
| 75°C to 79°C | |
| 173°C to 175°C | |
| Authentic | |
| Plastic bottle | |
| 0·5H2O | |
| 500 g | |
| Solubility in water: 7.7g/L (20°C). Other solubilities: soluble in ethanol,ether,chloroform,glycerol | |
| [HH].CC(C)(C(Cl)(Cl)Cl)O.O | |
| 186.47 | |
| 186.47 | |
| Crystalline Powder, Crystals or Chunks |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/protective clothing/eye protection/face protection.
GHS Signal Word: Warning
TSCA : TSCA
RUO – Research Use Only