Carboxylic acid esters
- (16)
- (79)
- (11)
- (3)
- (2)
- (22)
- (1)
- (84)
- (3)
- (2)
- (2)
- (8)
- (3)
- (4)
- (1)
- (1)
- (7)
- (15)
- (5)
- (2)
- (2)
- (5)
- (2)
- (4)
- (2)
- (4)
- (3)
- (1)
- (7)
- (6)
- (3)
- (3)
- (16)
- (3)
- (112)
- (8)
- (2)
- (2)
- (4)
- (2)
Résultats de la recherche filtrée
Thermo Scientific Chemicals Cefditoren pivoxyl
CAS: 117467-28-4 Formule moléculaire: C25H28N6O7S3 Poids moléculaire (g/mol): 620.71 Numéro MDL: MFCD00933166 Clé InChI: AFZFFLVORLEPPO-UHFFFAOYNA-N Nom IUPAC: {7-[2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyloxy}methyl 2,2-dimethylpropanoate SMILES: CON=C(C(=O)NC1C2SCC(C=CC3=C(C)N=CS3)=C(N2C1=O)C(=O)OCOC(=O)C(C)(C)C)C1=CSC(N)=N1
| Poids moléculaire (g/mol) | 620.71 |
|---|---|
| Numéro MDL | MFCD00933166 |
| CAS | 117467-28-4 |
| Nom IUPAC | {7-[2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyloxy}methyl 2,2-dimethylpropanoate |
| Clé InChI | AFZFFLVORLEPPO-UHFFFAOYNA-N |
| SMILES | CON=C(C(=O)NC1C2SCC(C=CC3=C(C)N=CS3)=C(N2C1=O)C(=O)OCOC(=O)C(C)(C)C)C1=CSC(N)=N1 |
| Formule moléculaire | C25H28N6O7S3 |
MilliporeSigma™ Dihydrorhodamine 123, Calbiochem™,
CAS: 109244-58-8 Formule moléculaire: C21H18N2O3 Poids moléculaire (g/mol): 346.39 Numéro MDL: MFCD04221428 Clé InChI: FNEZBBILNYNQGC-UHFFFAOYSA-N Synonyme: dihydrorhodamine 123,dihydrorhodamine,methyl 2-3,6-diamino-9h-xanthen-9-yl benzoate,benzoic acid, 2-3,6-diamino-9h-xanthen-9-yl-, methyl ester,dihydrorhodamine-123 CID PubChem: 105032 Nom IUPAC: methyl 2-(3,6-diamino-9H-xanthen-9-yl)benzoate SMILES: COC(=O)C1=CC=CC=C1C1C2=CC=C(N)C=C2OC2=CC(N)=CC=C12
| Poids moléculaire (g/mol) | 346.39 |
|---|---|
| Synonyme | dihydrorhodamine 123,dihydrorhodamine,methyl 2-3,6-diamino-9h-xanthen-9-yl benzoate,benzoic acid, 2-3,6-diamino-9h-xanthen-9-yl-, methyl ester,dihydrorhodamine-123 |
| Numéro MDL | MFCD04221428 |
| CAS | 109244-58-8 |
| CID PubChem | 105032 |
| Nom IUPAC | methyl 2-(3,6-diamino-9H-xanthen-9-yl)benzoate |
| Clé InChI | FNEZBBILNYNQGC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1C1C2=CC=C(N)C=C2OC2=CC(N)=CC=C12 |
| Formule moléculaire | C21H18N2O3 |
Dimethyl Fumarate, Certified Reference Material, MilliporeSigma™ Supelco™
Pharmaceutical secondary standards for application in quality control. Provides pharma laboratories and manufacturers with a convenient, and cost-effective alternative to the preparation of in-house working standards.
Mono-Methyl Phthalate Analytical Standard, MilliporeSigma™ Supelco™
Mono-Methyl phthalate belongs to the class of phthalates that is broadly employed as plasticizers in various domestic. Commonly used in industrial products, personal care products, pharmaceuticals, medical devices, and paints.
Methyl tiglate, 98%
CAS: 6622-76-0 Formule moléculaire: C6H10O2 Poids moléculaire (g/mol): 114.14 Numéro MDL: MFCD00016654 Clé InChI: YYJWBYNQJLBIGS-PLNGDYQASA-N Synonyme: methyl tiglate,tiglic acid methyl ester,methyl 2-methylbut-2-enoate,methyl 2-methyl-2-butenoate,methyl e-2-methylcrotonate,methyl 2-methylcrotonate,methyl alpha-methylcrotonate,methyl trans-2-methylcrotonate,2-butenoic acid, 2-methyl-, methyl ester, e,crotonic acid, 2-methyl-, methyl ester, e CID PubChem: 5323652 Nom IUPAC: methyl (E)-2-methylbut-2-enoate SMILES: COC(=O)C(\C)=C/C
| Poids moléculaire (g/mol) | 114.14 |
|---|---|
| Synonyme | methyl tiglate,tiglic acid methyl ester,methyl 2-methylbut-2-enoate,methyl 2-methyl-2-butenoate,methyl e-2-methylcrotonate,methyl 2-methylcrotonate,methyl alpha-methylcrotonate,methyl trans-2-methylcrotonate,2-butenoic acid, 2-methyl-, methyl ester, e,crotonic acid, 2-methyl-, methyl ester, e |
| Numéro MDL | MFCD00016654 |
| CAS | 6622-76-0 |
| CID PubChem | 5323652 |
| Nom IUPAC | methyl (E)-2-methylbut-2-enoate |
| Clé InChI | YYJWBYNQJLBIGS-PLNGDYQASA-N |
| SMILES | COC(=O)C(\C)=C/C |
| Formule moléculaire | C6H10O2 |
Ethyl tiglate, 98%
CAS: 5837-78-5 Formule moléculaire: C7H12O2 Poids moléculaire (g/mol): 128.171 Numéro MDL: MFCD00015183 Clé InChI: OAPHLAAOJMTMLY-GQCTYLIASA-N Synonyme: ethyl tiglate,tiglic acid, ethyl ester,ethyl 2-methylcrotonate,ethyl alpha-methylcrotonate,ethyl trans-2-methyl-2-butenoate,e-2-methyl-2-butenoic acid ethyl ester,ethyl e-2-methylcrotonate,ethyl trans-2-methylcrotonate,tiglic acid ethyl ester,ethyl 2-methylbut-2-enoate CID PubChem: 5281163 ChEBI: CHEBI:4892 Nom IUPAC: ethyl (E)-2-methylbut-2-enoate SMILES: CCOC(=O)C(=CC)C
| Poids moléculaire (g/mol) | 128.171 |
|---|---|
| Synonyme | ethyl tiglate,tiglic acid, ethyl ester,ethyl 2-methylcrotonate,ethyl alpha-methylcrotonate,ethyl trans-2-methyl-2-butenoate,e-2-methyl-2-butenoic acid ethyl ester,ethyl e-2-methylcrotonate,ethyl trans-2-methylcrotonate,tiglic acid ethyl ester,ethyl 2-methylbut-2-enoate |
| Numéro MDL | MFCD00015183 |
| CAS | 5837-78-5 |
| CID PubChem | 5281163 |
| ChEBI | CHEBI:4892 |
| Nom IUPAC | ethyl (E)-2-methylbut-2-enoate |
| Clé InChI | OAPHLAAOJMTMLY-GQCTYLIASA-N |
| SMILES | CCOC(=O)C(=CC)C |
| Formule moléculaire | C7H12O2 |
2-Ethylhexyl methacrylate, 98%, stab. with 4-methoxyphenol
CAS: 688-84-6 Formule moléculaire: C12H22O2 Poids moléculaire (g/mol): 198.306 Numéro MDL: MFCD00009494 Clé InChI: WDQMWEYDKDCEHT-UHFFFAOYSA-N Synonyme: 2-ethylhexyl methacrylate,2-ethyl-1-hexyl methacrylate,2-ethylhexyl methacryate,2-propenoic acid, 2-methyl-, 2-ethylhexyl ester,methacrylic acid 2-ethylhexyl ester,methacrylic acid, 2-ethylhexyl ester,methacrylate, 2-ethylisohexy,2-ethylhexylmethacrylate,dsstox_cid_7293,dsstox_rid_78391 CID PubChem: 12713 Nom IUPAC: 2-ethylhexyl 2-methylprop-2-enoate SMILES: CCCCC(CC)COC(=O)C(=C)C
| Poids moléculaire (g/mol) | 198.306 |
|---|---|
| Synonyme | 2-ethylhexyl methacrylate,2-ethyl-1-hexyl methacrylate,2-ethylhexyl methacryate,2-propenoic acid, 2-methyl-, 2-ethylhexyl ester,methacrylic acid 2-ethylhexyl ester,methacrylic acid, 2-ethylhexyl ester,methacrylate, 2-ethylisohexy,2-ethylhexylmethacrylate,dsstox_cid_7293,dsstox_rid_78391 |
| Numéro MDL | MFCD00009494 |
| CAS | 688-84-6 |
| CID PubChem | 12713 |
| Nom IUPAC | 2-ethylhexyl 2-methylprop-2-enoate |
| Clé InChI | WDQMWEYDKDCEHT-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)C(=C)C |
| Formule moléculaire | C12H22O2 |
n-Butylidenephthalide, (E)+(Z), 95%
CAS: 551-08-6 Formule moléculaire: C12H12O2 Poids moléculaire (g/mol): 188.23 Numéro MDL: MFCD00047319,MFCD00047319 Clé InChI: WMBOCUXXNSOQHM-DHZHZOJOSA-N Synonyme: ligusticum lactone,butylidene phthalide,n-butylidene phthalide,3-butylidene-1 3h-isobenzofuranone,3-butylidenephthalide,phthalide, 3-butylidene,fema no. 3333,bdph,3-butylidene phthalide,1 3h-isobenzofuranone, 3-butylidene CID PubChem: 5352899 Nom IUPAC: (3E)-3-butylidene-2-benzofuran-1-one SMILES: CCC\C=C1\OC(=O)C2=CC=CC=C12
| Poids moléculaire (g/mol) | 188.23 |
|---|---|
| Synonyme | ligusticum lactone,butylidene phthalide,n-butylidene phthalide,3-butylidene-1 3h-isobenzofuranone,3-butylidenephthalide,phthalide, 3-butylidene,fema no. 3333,bdph,3-butylidene phthalide,1 3h-isobenzofuranone, 3-butylidene |
| Numéro MDL | MFCD00047319,MFCD00047319 |
| CAS | 551-08-6 |
| CID PubChem | 5352899 |
| Nom IUPAC | (3E)-3-butylidene-2-benzofuran-1-one |
| Clé InChI | WMBOCUXXNSOQHM-DHZHZOJOSA-N |
| SMILES | CCC\C=C1\OC(=O)C2=CC=CC=C12 |
| Formule moléculaire | C12H12O2 |
Dimethyl acetylenedicarboxylate, 95%
CAS: 762-42-5 Formule moléculaire: C6H6O4 Poids moléculaire (g/mol): 142.11 Numéro MDL: MFCD00008456 Clé InChI: VHILMKFSCRWWIJ-UHFFFAOYSA-N Synonyme: dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene CID PubChem: 12980 Nom IUPAC: dimethyl but-2-ynedioate SMILES: COC(=O)C#CC(=O)OC
| Poids moléculaire (g/mol) | 142.11 |
|---|---|
| Synonyme | dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene |
| Numéro MDL | MFCD00008456 |
| CAS | 762-42-5 |
| CID PubChem | 12980 |
| Nom IUPAC | dimethyl but-2-ynedioate |
| Clé InChI | VHILMKFSCRWWIJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C#CC(=O)OC |
| Formule moléculaire | C6H6O4 |
Methyl 4-aminobenzoate, 98%
CAS: 619-45-4 Formule moléculaire: C8H9NO2 Poids moléculaire (g/mol): 151.165 Numéro MDL: MFCD00007891 Clé InChI: LZXXNPOYQCLXRS-UHFFFAOYSA-N Synonyme: 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester CID PubChem: 12082 Nom IUPAC: methyl 4-aminobenzoate SMILES: COC(=O)C1=CC=C(C=C1)N
| Poids moléculaire (g/mol) | 151.165 |
|---|---|
| Synonyme | 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester |
| Numéro MDL | MFCD00007891 |
| CAS | 619-45-4 |
| CID PubChem | 12082 |
| Nom IUPAC | methyl 4-aminobenzoate |
| Clé InChI | LZXXNPOYQCLXRS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)N |
| Formule moléculaire | C8H9NO2 |
Methyl 1-methylpyrrole-2-carboxylate, 99%
CAS: 37619-24-2 Formule moléculaire: C7H9NO2 Poids moléculaire (g/mol): 139.154 Numéro MDL: MFCD00052747 Clé InChI: APHVGKYWHWFAQV-UHFFFAOYSA-N Synonyme: methyl 1-methyl-1h-pyrrole-2-carboxylate,methyl1-methyl-1h-pyrrole-2-carboxylate,1-methyl-1h-pyrrole-2-carboxylic acid methyl ester,methyl 1-methyl-2-pyrrolecarboxylate,1-methylpyrrole-2-carboxylic acid methyl ester,pubchem12438,acmc-209iue,methylmethylpyrrolecarboxylate,2-methoxycarbonyl-1-methylpyrrole,methyl 1-methyl-pyrrole-2-carboxylate CID PubChem: 142178 Nom IUPAC: methyl 1-methylpyrrole-2-carboxylate SMILES: CN1C=CC=C1C(=O)OC
| Poids moléculaire (g/mol) | 139.154 |
|---|---|
| Synonyme | methyl 1-methyl-1h-pyrrole-2-carboxylate,methyl1-methyl-1h-pyrrole-2-carboxylate,1-methyl-1h-pyrrole-2-carboxylic acid methyl ester,methyl 1-methyl-2-pyrrolecarboxylate,1-methylpyrrole-2-carboxylic acid methyl ester,pubchem12438,acmc-209iue,methylmethylpyrrolecarboxylate,2-methoxycarbonyl-1-methylpyrrole,methyl 1-methyl-pyrrole-2-carboxylate |
| Numéro MDL | MFCD00052747 |
| CAS | 37619-24-2 |
| CID PubChem | 142178 |
| Nom IUPAC | methyl 1-methylpyrrole-2-carboxylate |
| Clé InChI | APHVGKYWHWFAQV-UHFFFAOYSA-N |
| SMILES | CN1C=CC=C1C(=O)OC |
| Formule moléculaire | C7H9NO2 |
Methyl biphenyl-4-carboxylate, 98+%
CAS: 720-75-2 Formule moléculaire: C14H12O2 Poids moléculaire (g/mol): 212.25 Numéro MDL: MFCD00017200 Clé InChI: GATUGNVDXMYTJX-UHFFFAOYSA-N Synonyme: methyl 4-biphenylcarboxylate,methyl biphenyl-4-carboxylate,methyl 1,1'-biphenyl-4-carboxylate,methyl p-phenylbenzoate,4-biphenylcarboxylic acid, methyl ester,1,1'-biphenyl-4-carboxylic acid, methyl ester,p-phenylbenzoic acid methyl ester,methyl-4-phenylbenzoate,4-phenylbenzoic acid methyl ester CID PubChem: 69757 Nom IUPAC: methyl 4-phenylbenzoate SMILES: COC(=O)C1=CC=C(C=C1)C1=CC=CC=C1
| Poids moléculaire (g/mol) | 212.25 |
|---|---|
| Synonyme | methyl 4-biphenylcarboxylate,methyl biphenyl-4-carboxylate,methyl 1,1'-biphenyl-4-carboxylate,methyl p-phenylbenzoate,4-biphenylcarboxylic acid, methyl ester,1,1'-biphenyl-4-carboxylic acid, methyl ester,p-phenylbenzoic acid methyl ester,methyl-4-phenylbenzoate,4-phenylbenzoic acid methyl ester |
| Numéro MDL | MFCD00017200 |
| CAS | 720-75-2 |
| CID PubChem | 69757 |
| Nom IUPAC | methyl 4-phenylbenzoate |
| Clé InChI | GATUGNVDXMYTJX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C1=CC=CC=C1 |
| Formule moléculaire | C14H12O2 |
Methyl cyanoacetate, 99%
CAS: 105-34-0 Formule moléculaire: C4H5NO2 Poids moléculaire (g/mol): 99.09 Numéro MDL: MFCD00001939 Clé InChI: ANGDWNBGPBMQHW-UHFFFAOYSA-N Synonyme: methyl cyanoacetate,cyanoacetic acid methyl ester,methyl cyanoethanoate,acetic acid, cyano-, methyl ester,usaf kf-22,methylester kyseliny kyanoctove,methylcyanoacetate,malonic methyl ester nitrile,acetic acid, 2-cyano-, methyl ester,methyl cyano acetate CID PubChem: 7747 ChEBI: CHEBI:51928 Nom IUPAC: methyl 2-cyanoacetate SMILES: COC(=O)CC#N
| Poids moléculaire (g/mol) | 99.09 |
|---|---|
| Synonyme | methyl cyanoacetate,cyanoacetic acid methyl ester,methyl cyanoethanoate,acetic acid, cyano-, methyl ester,usaf kf-22,methylester kyseliny kyanoctove,methylcyanoacetate,malonic methyl ester nitrile,acetic acid, 2-cyano-, methyl ester,methyl cyano acetate |
| Numéro MDL | MFCD00001939 |
| CAS | 105-34-0 |
| CID PubChem | 7747 |
| ChEBI | CHEBI:51928 |
| Nom IUPAC | methyl 2-cyanoacetate |
| Clé InChI | ANGDWNBGPBMQHW-UHFFFAOYSA-N |
| SMILES | COC(=O)CC#N |
| Formule moléculaire | C4H5NO2 |
Methyl 4-chlorocinnamate, 99%
CAS: 7560-44-3 Formule moléculaire: C10H9ClO2 Poids moléculaire (g/mol): 196.63 Numéro MDL: MFCD00075790 Clé InChI: IIBXQGYKZKOORG-QPJJXVBHSA-N Synonyme: methyl 4-chlorocinnamate,methyl p-chlorocinnamate,methyl 3-4-chlorophenyl acrylate,4-chlorocinnamic acid methyl ester,cinnamic acid, p-chloro-, methyl ester,2-propenoic acid, 3-4-chlorophenyl-, methyl ester,methyl e-3-4-chlorophenyl prop-2-enoate,e-methyl 3-4-chlorophenyl acrylate,methyl 2e-3-4-chlorophenyl prop-2-enoate,methyl 3-4-chlorophenyl prop-2-enoate CID PubChem: 5314314 Nom IUPAC: methyl (E)-3-(4-chlorophenyl)prop-2-enoate SMILES: COC(=O)C=CC1=CC=C(C=C1)Cl
| Poids moléculaire (g/mol) | 196.63 |
|---|---|
| Synonyme | methyl 4-chlorocinnamate,methyl p-chlorocinnamate,methyl 3-4-chlorophenyl acrylate,4-chlorocinnamic acid methyl ester,cinnamic acid, p-chloro-, methyl ester,2-propenoic acid, 3-4-chlorophenyl-, methyl ester,methyl e-3-4-chlorophenyl prop-2-enoate,e-methyl 3-4-chlorophenyl acrylate,methyl 2e-3-4-chlorophenyl prop-2-enoate,methyl 3-4-chlorophenyl prop-2-enoate |
| Numéro MDL | MFCD00075790 |
| CAS | 7560-44-3 |
| CID PubChem | 5314314 |
| Nom IUPAC | methyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| Clé InChI | IIBXQGYKZKOORG-QPJJXVBHSA-N |
| SMILES | COC(=O)C=CC1=CC=C(C=C1)Cl |
| Formule moléculaire | C10H9ClO2 |
Dimethyl maleate, 96%
CAS: 624-48-6 Formule moléculaire: C6H8O4 Poids moléculaire (g/mol): 144.126 Numéro MDL: MFCD00008459 Clé InChI: LDCRTTXIJACKKU-ARJAWSKDSA-N Synonyme: dimethyl maleate,maleic acid, dimethyl ester,methyl maleate,sipomer dmm,maleic acid dimethyl ester,dimethyl cis-butenedioate,2-butenedioic acid z-, dimethyl ester,dimethyl cis-ethylenedicarboxylate,2-butenedioic acid 2z-, dimethyl ester,2-butenedioic acid, dimethyl ester, z CID PubChem: 5271565 ChEBI: CHEBI:35460 Nom IUPAC: dimethyl (Z)-but-2-enedioate SMILES: COC(=O)C=CC(=O)OC
| Poids moléculaire (g/mol) | 144.126 |
|---|---|
| Synonyme | dimethyl maleate,maleic acid, dimethyl ester,methyl maleate,sipomer dmm,maleic acid dimethyl ester,dimethyl cis-butenedioate,2-butenedioic acid z-, dimethyl ester,dimethyl cis-ethylenedicarboxylate,2-butenedioic acid 2z-, dimethyl ester,2-butenedioic acid, dimethyl ester, z |
| Numéro MDL | MFCD00008459 |
| CAS | 624-48-6 |
| CID PubChem | 5271565 |
| ChEBI | CHEBI:35460 |
| Nom IUPAC | dimethyl (Z)-but-2-enedioate |
| Clé InChI | LDCRTTXIJACKKU-ARJAWSKDSA-N |
| SMILES | COC(=O)C=CC(=O)OC |
| Formule moléculaire | C6H8O4 |