missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Tris(trimethylsilyl) Borate 97.0+%, TCI America™
Supplier: TCI America T254325G
Specifications
| Tris(trimethylsilyl) Borate | |
| -35°C | |
| 180°C | |
| MFCD00051588 | |
| 1993 | |
| YZYKZHPNRDIPFA-UHFFFAOYSA-N | |
| tris(trimethylsilyl) borate | |
| 78020 | |
| ≥97.0% (T) |
| 4325-85-3 | |
| Yellow | |
| C9H27BO3Si3 | |
| 25 g | |
| tris trimethylsilyl borate, tris trimethylsiloxy boron, silanol, trimethyl-, triester with boric acid h3bo3, tritrimethylsilyl borate, borane, tris trimethylsiloxy, silanol, 1,1,1-trimethyl-, 1,1',1-triester with boric acid h3bo3, acmc-209jtk, tris trimethylsiloxy borane, boric acid, 3tms derivative | |
| B(O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C | |
| 278.377 | |
| 278.38 | |
| Liquid |
Chemical Identifiers
| 4325-85-3 | |
| 278.377 | |
| YZYKZHPNRDIPFA-UHFFFAOYSA-N | |
| 78020 | |
| B(O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| C9H27BO3Si3 | |
| MFCD00051588 | |
| tris trimethylsilyl borate, tris trimethylsiloxy boron, silanol, trimethyl-, triester with boric acid h3bo3, tritrimethylsilyl borate, borane, tris trimethylsiloxy, silanol, 1,1,1-trimethyl-, 1,1',1-triester with boric acid h3bo3, acmc-209jtk, tris trimethylsiloxy borane, boric acid, 3tms derivative | |
| tris(trimethylsilyl) borate |
Safety and Handling
TSCA : Yes