missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
β-Nicotinamide adenine dinucleotide phosphate sodium salt hydrate, 97+%, ACROS Organics™
Manufacturer: Fisher Scientific Acros 227575000
Specifications
| 0.80 to 0.86 (A250/A260,pH 7.5),0.18 to 0.24 (A280/A260,pH 7.5) | |
| Authentic | |
| 6% Max. (K.F.) | |
| 175.0°C to 178.0°C | |
| 698999-85-8 | |
| C21H27N7NaO17P3·xH2O | |
| 14,6348 | |
| Solubility in water: soluble. Other solubilities: soluble in methanol,less soluble in ethanol,practically insoluble in ether and ethyl acetate | |
| C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)N4C=NC5=C4N=CN=C5N)OP(=O)(O)O)O)O)O)C(=O)N.[Na] | |
| 765.39 | |
| 765.39 | |
| 97+% |
| β-Nicotinamide adenine dinucleotide phosphate sodium salt hydrate | |
| Glass bottle | |
| White to Yellow | |
| 500mg | |
| determination,based on dry weight) | |
| MFCD00150480 | |
| beta-nicotinamide adenine dinucleotide phosphate sodium, nadp sodium salt | |
| ZUXQIVQXILFYQI-QYZPTAICSA-N | |
| [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;sodium | |
| 131845262 | |
| Powder |
Chemical Identifiers
| 698999-85-8 | |
| 765.39 | |
| ZUXQIVQXILFYQI-QYZPTAICSA-N | |
| 131845262 | |
| C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)N4C=NC5=C4N=CN=C5N)OP(=O)(O)O)O)O)O)C(=O)N.[Na] |
| C21H27N7NaO17P3·xH2O | |
| MFCD00150480 | |
| beta-nicotinamide adenine dinucleotide phosphate sodium, nadp sodium salt | |
| [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;sodium |
Safety and Handling
EINECSNumber : 214-664-6