missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Trimethylacetic anhydride, 99%, ACROS Organics™
$457.10 - $457.10
Chemical Identifiers
| CAS | 1538-75-6 |
|---|---|
| Molecular Formula | C10H18O3 |
| Molecular Weight (g/mol) | 186.25 |
| MDL Number | MFCD00008842 |
| InChI Key | PGZVFRAEAAXREB-UHFFFAOYSA-N |
| Synonym | 2,2-dimethylpropanoic anhydride, 2,2-dimethylpropionic anhydride, bispivalic anhydride, pivalic anhydride, pivalic anydride, propanoic acid, 2,2-dimethyl-, 1,1'-anhydride, propanoic acid, 2,2-dimethyl-, anhydride, trimethylacetic acid anhydride, trimethylacetic anhydride, trimethylaceticanhydride |
| PubChem CID | 15234 |
| IUPAC Name | 2,2-dimethylpropanoyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(=O)C(C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC162442500
|
Thermo Fisher Scientific
AC162442500 |
250mL | Glass bottle |
Each for $457.10
|
|
AC162440010
|
Thermo Fisher Scientific
AC162440010 |
1L | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 1538-75-6 | |
| 186.25 | |
| PGZVFRAEAAXREB-UHFFFAOYSA-N | |
| 15234 | |
| CC(C)(C)C(=O)OC(=O)C(C)(C)C |
| C10H18O3 | |
| MFCD00008842 | |
| 2,2-dimethylpropanoic anhydride, 2,2-dimethylpropionic anhydride, bispivalic anhydride, pivalic anhydride, pivalic anydride, propanoic acid, 2,2-dimethyl-, 1,1'-anhydride, propanoic acid, 2,2-dimethyl-, anhydride, trimethylacetic acid anhydride, trimethylacetic anhydride, trimethylaceticanhydride | |
| 2,2-dimethylpropanoyl 2,2-dimethylpropanoate |
Specifications
| 0.9100g/mL | |
| Authentic | |
| 1.4080 to 1.4100 | |
| 193.0°C | |
| 250mL | |
| 98.5% min. (GC) | |
| [(CH3)3CCO]2O | |
| 02,32 | |
| Solubility in water: decomposes in water | |
| CC(C)(C)C(=O)OC(=O)C(C)(C)C | |
| 186.25 | |
| 186.25 | |
| 99% |
| 57°C | |
| Glass bottle | |
| 0.91 | |
| Colorless | |
| 1538-75-6 | |
| C10H18O3 | |
| MFCD00008842 | |
| 2,2-dimethylpropanoic anhydride, 2,2-dimethylpropionic anhydride, bispivalic anhydride, pivalic anhydride, pivalic anydride, propanoic acid, 2,2-dimethyl-, 1,1'-anhydride, propanoic acid, 2,2-dimethyl-, anhydride, trimethylacetic acid anhydride, trimethylacetic anhydride, trimethylaceticanhydride | |
| PGZVFRAEAAXREB-UHFFFAOYSA-N | |
| 2,2-dimethylpropanoyl 2,2-dimethylpropanoate | |
| 15234 | |
| Liquid | |
| Trimethylacetic anhydride |
Safety and Handling
GHS H Statement
Flammable liquid and vapor.
GHS P Statement
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 216-263-1