missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Triisopropanolamine cyclic borate, 98+%, ACROS Organics™
$355.58 - $355.58
Chemical Identifiers
| CAS | 101-00-8 |
|---|---|
| Molecular Formula | C9H18BNO3 |
| Molecular Weight (g/mol) | 199.06 |
| MDL Number | MFCD03791298 |
| InChI Key | IWKGJTDSJPLUCE-UHFFFAOYSA-N |
| Synonym | 2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, 3,7,10-trimethyl, 2-propanol, 1,1',1-nitrilotri-, cyclic borate, 3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo 3.3.3 undecane, borester 21, boric acid, tris 1-amino-2-propyl ester, triisopropanolamine borate, triisopropanolamine cyclic borate, triisopropanolamineborate |
| PubChem CID | 225550 |
| IUPAC Name | 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo[3.3.3]undecane |
| SMILES | B12OC(CN(CC(O1)C)CC(O2)C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC269241000
|
Thermo Fisher Scientific
269241000 |
100g | Glass bottle |
Each for $355.58
|
|
AC269245000
|
Thermo Fisher Scientific
AC269245000 |
500g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 101-00-8 | |
| 199.06 | |
| IWKGJTDSJPLUCE-UHFFFAOYSA-N | |
| 225550 | |
| B12OC(CN(CC(O1)C)CC(O2)C)C |
| C9H18BNO3 | |
| MFCD03791298 | |
| 2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, 3,7,10-trimethyl, 2-propanol, 1,1',1-nitrilotri-, cyclic borate, 3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo 3.3.3 undecane, borester 21, boric acid, tris 1-amino-2-propyl ester, triisopropanolamine borate, triisopropanolamine cyclic borate, triisopropanolamineborate | |
| 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo[3.3.3]undecane |
Specifications
| Authentic | |
| White to Yellow | |
| 100g | |
| 98% min. (GC) | |
| MFCD03791298 | |
| IWKGJTDSJPLUCE-UHFFFAOYSA-N | |
| 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo[3.3.3]undecane | |
| 225550 | |
| Crystalline Chunks and Needles | |
| Triisopropanolamine cyclic borate |
| Glass bottle | |
| 150°C to 157°C | |
| 101-00-8 | |
| C9H18BNO3 | |
| 2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, 3,7,10-trimethyl, 2-propanol, 1,1',1-nitrilotri-, cyclic borate, 3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo 3.3.3 undecane, borester 21, boric acid, tris 1-amino-2-propyl ester, triisopropanolamine borate, triisopropanolamine cyclic borate, triisopropanolamineborate | |
| B12OC(CN(CC(O1)C)CC(O2)C)C | |
| 199.06 | |
| 199.06 | |
| 98+% |